| Vinclozolin (Ref: BAS 352F) |
(Also known as: vinclozoline; vorlan) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate
 |
Human health High alert: Endocrine distrupter; Reproduction/development effects
 |
|
|
A fungicide used mainly to control Botrytis, Monolinia and Sclerotinia spp. |
|
|
Downy mildew; Powdery mildew; Crown & stem rot |
|
|
Oilseed rape; Grape vines; Fruit including strawberries, raspberries; Vegetables; Turf |
|
|
- |
|
|
- |
|
|
1976, Germany |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Chiral, a specific isomer or a derivative of a chiral molecule |
|
|
C₁₂H₉Cl₂NO₃ |
|
|
CC1(C(=O)N(C(=O)O1)C2=CC(=CC(=C2)Cl)Cl)C=C |
|
|
No data |
|
|
FSCWZHGZWWDELK-UHFFFAOYSA-N |
|
|
InChI=1S/C12H9Cl2NO3/c1-3-12(2)10(16)15(11(17)18-12)9-5-7(13)4-8(14)6-9/h3-6H,1H2,2H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| vinclozolin |
Unstated isomer |
 |
|
|
Fungicide |
|
|
Oxazole fungicide; Dicarboximide fungicide; Dichlorophenyl dicarboximide fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic with protective action, prevents spore germination and mycelial growth. Osmotic signal transduction. |
|
|
50471-44-8 |
|
|
256-599-6 |
|
|
280 |
|
|
113201 |
|
|
39676 |
|
|
607-307-00-4 |
|
|
286.11 |
|
|
rac-(5R)-3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl-1,3-oxazolidine-2,4-dione |
|
|
(RS)-3-(3,5-dichlorophenyl)-5-methyl-5-vinyl-1,3-oxazolidine-2,4-dione |
|
|
3-(3,5-dichlorophenyl)-5-ethenyl-5-methyl-2,4-oxazolidinedione |
|
|
OSPAR soc; Chemical subject to PIC regulations |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
2 |
|
|
- |
|
|
Colourless crystals |
|
|
|
|
|
|
|
|
|
|
|
Usually formulated as a wettable powder |
|
|
|
|
|
|
|
3.4 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
|
281000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Ethyl acetate |
- |
| 551000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Acetone |
- |
| 164000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Benzene |
- |
| 128000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Xylene |
- |
|
|
108 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.05 X 1003 |
Calculated |
- |
|
|
3.02 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
High |
|
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
1.51 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.016 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
1.35 X 10-03 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
12 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Non-persistent |
|
|
40.5 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately persistent |
|
|
20 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: lab studies DT₅₀ range 28-43 days, field studies DT₅₀ range 34-94 days (R3) |
|
|
|
4.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.5-9.2 days, 3 crops, field & undercover, various matrices, n=6 |
|
|
|
10.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 6.6-10.8 days, 3 crops, field & undercover, various matrices, n=4 |
|
|
|
27 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Slow |
|
|
- |
|
|
|
1.3 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
Non-persistent |
|
|
- |
|
|
15 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Fast |
|
|
46 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Stable |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Moderately mobile |
|
|
300 |
|
|
Koc range 260-535 mL g⁻¹; Other studies: Koc - 100 (M4) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.98 |
Calculated |
Transition state |
|
|
|
6.26 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
6.5 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 15000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
2.8 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
High |
|
|
50.0 |
- |
|
|
- |
- |
- |
|
|
> 5629 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
> 100 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Moderately harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Harmless |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
2.84 |
Oncorhynchus mykiss |
Moderate |
|
|
0.7 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas |
Moderate |
|
|
3.65 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
Moderate |
|
|
0.79 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna growth |
Moderate |
|
|
1.5 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.9 |
Lemna gibba 5 day |
Moderate |
|
|
1.02 |
Pseudokirchneriella subcapitata 5 day |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 15000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
29.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Renal and prostate gland toxicant- androgen USEPA - possible human carcinogen Endocrine issues - Competitive binding to androgen receptor |
|
|
|
|
|
No information available |
|
|
Health: H317, H351, H360FD Environment: H411 |
|
|
U (Unlikely to present an acute hazard) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
vinclozolin |
|
|
vinclozoline |
|
|
Vinclozolin |
|
|
vinclozolin |
|
|
vinclozolin |
|
|
vinclozolina |
|
|
vinklozolin |
|
|
winklozolina |
|
|
- |
|
|
vinklozolin |
|
|
vinklozolin |
|
|
- |