| Trifludimoxazin |
(Not known by any other names) |
| A fast acting herbicide used to control broad-leaved and grass weeds. Trifludimoxazin has a low aqueous solubility and a low volatility. It is not expected to be persistent in soils. It demonstrates a low toxicity to most fauna and flora. Trifludimoxazin has a low mammalian toxicity if ingested and no serious health implications have been idenified. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
|
A fast acting herbicide used to control broad-leaved and grass weeds |
|
|
Broad-leaved weeds; Grass weeds |
|
|
Corn; Soybean; Cereal grains; Peanuts; Citrus |
|
|
- |
|
|
Current |
|
|
2020 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₆H₁₁F₃N₄O₄S |
|
|
CN1C(=O)N(C(=O)N(C1=S)C)C2=CC3=C(C=C2F)OC(C(=O)N3CC#C)(F)F |
|
|
- |
|
|
AZHZOGYUMMIAOF-UHFFFAOYSA-N |
|
|
InChI=1S/C16H11F3N4O4S/c1-4-5-22-10-7-9(8(17)6-11(10)27-16(18,19)12(22)24)23-13(25)20(2)15(28)21(3)14(23)26/h1,6-7H,5H2,2-3H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Triazinone herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
PPO inhibitor thus blocks the synthesis of chlorophylls |
|
|
1258836-72-4 |
|
|
No data found |
|
|
- |
|
|
- |
|
|
49831143 |
|
|
No data found |
|
|
412.3 |
|
|
1,5-dimethyl-6-thioxo-3-[2,2,7-trifluoro-3-oxo-4-(prop-2-yn-1-yl)-3,4-dihydro-2H-1,4-benzoxazin-6-yl]-1,3,5-triazinane-2,4-dione |
|
|
1,5-dimethyl-6-thioxo-3-[2,2,7-trifluoro-3,4-dihydro-3-oxo-4-(prop-2-ynyl)-2H-1,4-benzoxazin-6-yl]-1,3,5-triazinane-2,4-dione |
|
|
dihydro-1,5-dimethyl-6-thioxo-3-[2,2,7-trifluoro-3,4-dihydro-3-oxo-4-(2-propyn-1-yl)-2H-1,4-benzoxazin-6-yl]-1,3,5-triazine-2,4(1H,3H)-dione |
|
|
- |
|
|
- |
|
|
E |
|
|
14 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white coloured crystalline powder |
|
|
|
|
|
|
|
|
|
|
|
Usually supplied as a suspension concentrate |
|
|
|
|
|
|
|
1.78 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low |
|
|
423800 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Acetone |
- |
| 155200 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Ethyl acetate |
- |
| 10800 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Methanol |
- |
| 36000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Toluene |
- |
|
|
206 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
|
Decomposed before boiling |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
|
225 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
|
- |
- |
- |
|
|
|
2.14 X 1003 |
Calculated |
- |
|
|
3.33 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.598 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
- |
|
|
- |
- |
- |
| - |
|
|
1.1 X 10-07 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Low volatility |
|
|
2.5 X 10-08 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
52 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Moderately persistent |
|
|
52 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Moderately persistent |
|
|
14 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Australian field data: DT₅₀ 6.6–42 days, geomean 14 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
- |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes |
Moderately mobile |
|
|
436 |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.56 |
Calculated |
Low leachability |
|
|
|
3.15 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Unknown species |
Low |
|
|
561 mg kg bw⁻¹ day⁻¹ |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Anas platyrhynchos |
- |
|
|
- |
- |
- |
|
|
> 500 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Eisenia foetida corr |
Moderate |
|
|
154 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Eisenia andrei corr |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Apis mellifera |
Low |
|
|
> 100 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 41 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
> 1.9 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
P5 P = Other non-EU, UK or US Governments and Regulators 5 = Verified data used for regulatory purposes Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
|
| No data found |
XNo, known not to cause a problem |
|
|
|
|
Possible liver toxicant |
|
|
|
|
|
Not expected to autoignite; Not highly flammable |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
trifludimoxazin |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |