| Trifloxysulfuron-sodium (Ref: CGA 362622) |
(Also known as: CGA 362622) |
| Trifloxysulfuron-sodium is a post-emergence herbicide. It has a high aqueous solubility, is relatively volatile and, based on its chemical properties, is mobile and may leach to groundwater in some situations. It is moderately persistent in soil systems but is generally non-persistent in aquatic systems. It has a low mammalian toxicity and has a high potential to bioaccumulate. It is a skin and eye irritant. It is moderately toxic to birds, honey bees and earthworms but is less toxic to fish and daphnia. However, it is very toxic to aquatic plants and algae. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent; GUS: Transition state; Drainflow: Moderately mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
|
Post emergence herbicide for control of grasses, sedges and broad-leaved weeds |
|
|
Morning glory; Noogoora burr; Nutgrass; Burr medic; Sesbania pea; Yellow vine; Italian cockleburr |
|
|
Cotton; Sugarcane |
|
|
- |
|
|
Current |
|
|
2003, registration |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes (as the acid) |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₄H₁₃F₃N₅NaO₆S |
|
|
COC1=CC(=NC(=N1)NC(=O)[N-]S(=O)(=O)C2=C(C=CC=N2)OCC(F)(F)F)OC.[Na+] |
|
|
- |
|
|
UFEIWEXHHOXPGP-UHFFFAOYSA-M |
|
|
InChI=1S/C14H14F3N5O6S.Na/c1-26-9-6-10(27-2)20-12(19-9)21-13(23)22-29(24,25)11-8(4-3-5-18-11)28-7-14(15,16)17;/h3-6H,7H2,1-2H3,(H2,19,20,21,22,23);/q;+1/p-1/fC14H13F3N5O6S.Na/h22H;/q-1;m/b21-13-; |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| trifloxysulfuron hydrate |
Parent hydrate |
 |
|
|
Herbicide |
|
|
Sulfonylurea herbicide; Pyrimidinylsulfonylurea herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Aborbed by shoots and roots and translocated. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
|
|
199119-58-9 |
|
|
688-332-8 |
|
|
- |
|
|
119009 |
|
|
23676736 |
|
|
No data found |
|
|
459.33 |
|
|
sodium (4,6-dimethoxypyrimidin-2-yl){[3-(2,2,2-trifluoroethoxy)pyridine-2-sulfonyl]carbamoyl}azanide |
|
|
sodium N'-(4,6-dimethoxypyrimidin-2-yl)-N-[3-(2,2,2-trifluoroethoxy)-2-pyridylsulfonyl]imidocarbamate |
|
|
2-pyridinesulfonamide, N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-3-(2,2,2-trifluoroethoxy)-, monosodium salt |
|
|
- |
|
|
- |
|
|
B |
|
|
2 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White powder |
|
|
|
|
|
|
|
|
|
|
25700 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
17000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Acetone |
- |
| 3800 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Ethyl acetate |
- |
| 50000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Methanol |
- |
| 1.0 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Toluene |
- |
|
|
174 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.80 X 10-01 |
Calculated |
- |
|
|
-0.42 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.645 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
|
4.76 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
| Weak acid |
|
|
0.001 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Low volatility |
|
|
2.6 X 10-05 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
63.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
|
70 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Literature values DT₅₀ 45-80 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
18 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Slow |
|
|
- |
|
|
|
20 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately mobile |
|
|
306 |
|
|
General literature Koc range 29-584 mL g⁻¹; Other data source: 5000 mL g⁻¹ (US3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.79 |
Calculated |
Transition state |
|
|
|
2.38 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
500 |
- |
|
|
- |
- |
- |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 748 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
No effect on soil microbes |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
> 25 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Harmless |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Aphidius rhopalosiphi |
- |
|
|
76.9 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 103 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Low |
|
|
9.5 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
> 108 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Low |
|
|
0.55 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.00055 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Lemna gibba |
High |
|
|
0.0065 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Pseudokirchneriella subcapitata |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
5.03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Chronic exposure may cause protein metabolism disturbances, emphysema, and weight loss |
|
|
|
|
|
No information available |
|
|
Environment: H400, H410 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
trifloxysulfuron-sodium |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
trifloxisulfuron sodico |
|
|
- |
|
|
trifloksysulfuron sodowy |
|
|
- |
|
|
- |
|
|
- |
|
|
- |