| Trietazine (Ref: G 27901) |
(Also known as: NC 1667) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute unknown ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate
 Warning: Significant data are missing |
|
|
A herbicide used, often with linuron, for pre-emergence weed control in many different crops |
|
|
Annual monocots & dicots |
|
|
Potatoes; Legumes; Bananas; Citrus; Coffee; Maize; Sugarcane; Tea; Tobacco |
|
|
- |
|
|
- |
|
|
circa 1960 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₉H₁₆ClN₅ |
|
|
CCNC1=NC(=NC(=N1)Cl)N(CC)CC |
|
|
- |
|
|
HFBWPRKWDIRYNX-UHFFFAOYSA-N |
|
|
InChI=1S/C9H16ClN5/c1-4-11-8-12-7(10)13-9(14-8)15(5-2)6-3/h4-6H2,1-3H3,(H,11,12,13,14) |
|
|
Yes |
|
|
Herbicide |
|
|
Triazine herbicide; Chlorotriazine herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, absorbed through roots and leaves. Inhibits photosynthesis (photosystem II). |
|
|
1912-26-1 |
|
|
217-618-3 |
|
|
- |
|
|
080809 |
|
|
15951 |
|
|
No data found |
|
|
229.71 |
|
|
6-chloro-N2,N2,N4-triethyl-1,3,5-triazine-2,4-diamine |
|
|
6-chloro-N2,N2,N4-triethyl-1,3,5-triazine-2,4-diamine |
|
|
6-chloro-N,N,N'-triethyl-1,3,5-triazine-2,4-diamine |
|
|
Potential groundwater contaminant |
|
|
- |
|
|
C1 |
|
|
5 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Solid |
|
|
|
|
|
- Bayer CropScience
- FBC
- Ciba Geigy
|
|
|
|
|
|
Usually formulated as an suspension concentrate or wettable powder |
|
|
|
|
|
|
|
20 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
170000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| 30000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethanol |
- |
| 500000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Chloroform |
- |
|
|
102 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.19 X 1003 |
Calculated |
- |
|
|
3.34 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.22 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
1.88 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
| Strong acid |
|
|
8.97 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Moderately volatile |
|
|
9.29 X 10-03 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
60 |
S1 S = Expert judgement 1 = Estimated data with little or no verification |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
S2 S = Expert judgement 2 = Unverified data of unknown source |
Moderately mobile |
|
|
374 |
|
|
Predicted value also available - 1562 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.54 |
Calculated |
Transition state |
|
|
|
1.65 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
494 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
16 |
- |
|
|
- |
- |
- |
|
|
800 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Phasianidae |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
50 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
5.5 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Poecilia reticulata |
Moderate |
|
|
- |
- |
- |
|
|
21 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.13 |
S1 S = Expert judgement 1 = Estimated data with little or no verification Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
494 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
600 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No futher information available |
|
|
|
|
|
No information available |
|
|
Health: H302 Environment: H400 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
trietazine |
|
|
triétazine |
|
|
Trietazin |
|
|
trietazin |
|
|
trietazina |
|
|
trietazina |
|
|
- |
|
|
trietazyna |
|
|
- |
|
|
- |
|
|
- |
|
|
- |