| Triclopyr-triethylammonium |
(Also known as: triclopyr triethylamine ) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health High alert: Reproduction/development effects
 |
|
|
A herbicide for perennial broad-leaved and woody weed control mainly on uncultivated areas |
|
|
Alder; Blackberry; Boxelder; Buckthorn; Cottonwood; Gorse; Hawthorn; Mulberry; Sassafras; Wild rose; Burdock; Curly dock; Canada thistle; Mustard; Lambsquarter |
|
|
Uncultivated areas; Grassland; Plantations; Rangeland; Right-of-way; Industrial sites; Ornamental turf; Rice |
|
|
- |
|
|
Current |
|
|
1979; first registered |
|
|
Approved |
|
|
30/04/2024 |
|
|
Check label - may vary with formulation |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Poland/Hungary |
|
|
30/04/2023 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
|
✓ |
✓ |
✓ |
|
|
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
|
✓ |
|
|
✓ |
✓ |
|
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
✓ |
✓ |
✓ |
✓ |
|
|
✓ |
|
|
|
|
|
|
None |
|
|
C₁₃H₁₉Cl₃N₂O₃ |
|
|
CCN(CC)CC.C1=C(C(=NC(=C1Cl)Cl)OCC(=O)O)Cl |
|
|
- |
|
|
ROKVVMOXSZIDEG-UHFFFAOYSA-N |
|
|
InChI=1S/C7H4Cl3NO3.C6H15N/c8-3-1-4(9)7(11-6(3)10)14-2-5(12)13;1-4-7(5-2)6-3/h1H,2H2,(H,12,13);4-6H2,1-3H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Pyridine herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, systemic, absorbed through roots and foliage. Synthetic auxin. |
|
|
57213-69-1 |
|
|
260-625-1 |
|
|
- |
|
|
116002 |
|
|
42163 |
|
|
No data found |
|
|
357.66 |
|
|
[(3,5,6-trichloropyridin-2-yl)oxy]acetic acid—N,N-diethylethan-1-amine (1/1) |
|
|
3,5,6-trichloro-2-pyridyloxyacetic acid - triethylamine (1:1) |
|
|
2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetic acid compound with N,N-diethylethanamine (1:1) |
|
|
Potential groundwater pollutant |
|
|
- |
|
|
O |
|
|
4 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Clear fluffy solid |
|
|
|
|
|
|
|
|
|
|
|
- Garlon 3A EC
- Grandstand CA
- Redeem
|
|
|
Usually supplied as an emulsifiable concentrate. Not approved in the UK for aerial application. |
|
|
|
|
|
|
|
412000 |
|
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.70 X 1001 |
Calculated |
- |
|
|
1.23 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
23.03 |
|
Non-persistent |
|
|
23.05 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
84.76 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
EU 2018 dossier DT₅₀ (normalised) range 9.17-49.12 days, DT₉₀ (actual) range 30.5-163 days, Soils=10 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Mobile |
|
|
20 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
3.68 |
Calculated |
High leachability |
|
|
|
5.06 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
|
|
|
|
Major fraction |
0.853 |
- |
|
|
- |
- |
- |
| Known groundwater metabolites |
|
|
|
|
|
|
|
| 3,5,6-trichloro-2-methoxypyridine |
- |
Plant |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 735 |
Anas platyrhynchos |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
146 |
Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
|
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 471 |
Lepomis macrochirus |
Low |
|
|
- |
- |
- |
|
|
> 104.5 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
48.0 |
Lemna gibba |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Low |
|
|
2000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.03 |
as triclopyr |
- |
|
|
0.3 |
as triclopyr |
- |
|
|
- |
- |
- |
|
|
0.05 |
as triclopyr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Risk of serious damage to the eyes |
|
|
|
|
|
Incompatible with strong oxidising agents Highly flammable Corrosive |
|
|
Health: H317, H319, H315, H335, H336 Handling: H226 Environment: H411 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
triclopyr-triethylammonium |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |