| Triafamone (Ref: AE 1887198) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Low alert
 |
|
|
A pre- and post-emergence herbicide for important economically damaging grasses and broad-leaved weeds in rice |
|
|
Echinochloa crus-galli; Echinochloa colonum; Echinochloa oryzicola; Paspalum globsola; Sedges |
|
|
Directed seeded and transplanted paddy rice |
|
|
- |
|
|
Current |
|
|
circa 2012 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
South Korea; China; Japan |
|
|
None |
|
|
C₁₄H₁₃F₃N₄O₅S |
|
|
CN(C1=C(C=CC=C1F)C(=O)C2=NC(=NC(=N2)OC)OC)S(=O)(=O)C(F)F |
|
|
- |
|
|
GBHVIWKSEHWFDD-UHFFFAOYSA-N |
|
|
InChI=1S/C14H13F3N4O5S/c1-21(27(23,24)12(16)17)9-7(5-4-6-8(9)15)10(22)11-18-13(25-2)20-14(19-11)26-3/h4-6,12H,1-3H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Sulfonanilide herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective; Inhibition of acetolactate synthase (ALS), absorbed through foliage and roots |
|
|
874195-61-6 |
|
|
620-056-5 |
|
|
- |
|
|
- |
|
|
16004663 |
|
|
No data found |
|
|
406.34 |
|
|
N-(2-(4,6-dimethoxy-1,3,5-triazine-2-carbonyl)-6-fluorophenyl)-1,1-difluoro-N-methylmethanesulfonamide |
|
|
2-((4,6-dimethoxy-1,3,5-triazin-2-yl)carbonyl)-1,1,6'-trifluoro-N-methylmethanesulfonanilide |
|
|
N-(2-((4,6-dimethoxy-1,3,5-triazin-2-yl)carbonyl)-6-fluorophenyl)-1,1-difluoro-N-methylmethanesulfonamide |
|
|
- |
|
|
- |
|
|
B |
|
|
2 |
|
|
Not applicable |
|
|
Not applicable |
|
|
None identified |
|
|
White powdery solid |
|
|
|
|
|
|
|
33 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
105.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.16 X 1001 |
Calculated |
- |
|
|
1.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.53 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
- |
- |
- |
| - |
|
|
6.4 X 10-09 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low volatility |
|
|
6.3 X 10-05 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
10 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Data for paddy soils DT₅₀ < 10.0 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
10 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Fast |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
|
55.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 100 |
R4 R = Peer reviewed scientific publications 4 = Verified data Cyprinus carpio |
Low |
|
|
- |
- |
- |
|
|
> 50.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
6.23 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
|
> 5.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
0.019 |
R4 R = Peer reviewed scientific publications 4 = Verified data Japan |
- |
|
|
None allocated |
R4 R = Peer reviewed scientific publications 4 = Verified data Japan |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Liver and thyroid toxicant |
|
|
|
|
|
Not corrosive |
|
|
- |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
triafamone |
|
|
triafamone |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |