| Triadimefon |
(Also known as: triadimefone; triadimenol metabolite M01) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health High alert: Endocrine distrupter; Reproduction/development effects
 |
|
|
A common fungicide used to control fungal infections in many crops. It is also a pesticide transformation product |
|
|
Powdery mildew; Leaf rust; Stripe rust; Speckled leaf blotch; Septoria; Leaf scald |
|
|
Cereals including Wheat and barley; Peas; Grapevines; Curcubits; Sugarcane |
|
|
- |
|
|
Current |
|
|
1976 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule with one chiral centre. There is little notable difference in the biological activities of the different enantiomeric forms |
|
|
C₁₄H₁₆ClN₃O₂ |
|
|
CC(C)(C)C(=O)C(N1C=NC=N1)OC2=CC=C(C=C2)Cl |
|
|
No data |
|
|
WURBVZBTWMNKQT-UHFFFAOYSA-N |
|
|
InChI=1S/C14H16ClN3O2/c1-14(2,3)12(19)13(18-9-16-8-17-18)20-11-6-4-10(15)5-7-11/h4-9,13H,1-3H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| triadimefon |
Unstated isomer |
 |
|
|
Fungicide, Metabolite |
|
|
Soil |
|
|
Triazole fungicide; Conazole fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic with protective, curative and eradicant action. Disrupts membrane function. Sterol biosynthesis inhibitor. |
|
|
43121-43-3 |
|
|
256-103-8 |
|
|
352 |
|
|
109901 |
|
|
39385 |
|
|
606-037-00-4 |
|
|
293.8 |
|
|
rac-(1R)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-one |
|
|
(RS)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-one |
|
|
1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)-2-butanone |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
3 |
|
|
- |
|
|
Colourless crystals |
|
|
|
|
|
|
|
|
- Triadimefon 500WG
- Bayleton
- Amiral
|
|
|
Usually formulated as an emulsifiable concentrate or wettable powder |
|
|
|
|
|
|
|
70 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderate |
|
|
200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 99000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Isopropanol |
- |
| 6300 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
|
82.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
72 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
|
1.51 X 1003 |
Calculated |
- |
|
|
3.18 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.28 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
|
- |
- |
- |
| - |
|
|
0.02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
9.00 X 10-05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
26 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
3.9 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Ryegrass blades, n=1 |
|
|
|
4.3 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.6-16.0 days, 14 field & undercover grown crops, various matrices, n=17; RL₅₀ grapes in cold storage = 216 days |
|
|
|
0.8 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
|
- |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
Stable pH 3 to pH 9, 22 °C |
|
|
43 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately fast |
|
|
12 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately fast |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Moderately mobile |
|
|
300 |
|
|
- |
|
|
|
10.16 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Slightly mobile |
|
|
749 |
|
|
0.750 |
|
|
Literature data: Kf range 1.33-22.0 mL g⁻¹, Kfoc range 344-2095 mL g⁻¹, 1/n range 0.71-0.77, Soils=8 |
|
|
No |
|
|
|
|
|
|
|
1.59 |
Calculated |
Low leachability |
|
|
|
4.12 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
64.0 |
|
Low potential |
|
|
0.6 |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
300 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Moderate |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
300 |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Colinus virginianus |
Low |
|
|
> 880 mg kg bw⁻¹ day⁻¹ |
Colinus virginianus |
- |
|
|
- |
- |
- |
|
|
> 50 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
> 25 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
4.08 |
Oncorhynchus mykiss |
Moderate |
|
|
0.017 |
Pimephales promelas |
Moderate |
|
|
7.16 |
Daphnia magna |
Moderate |
|
|
0.1 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
2.01 |
Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
300 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Moderate |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
3.27 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
0.03 |
|
- |
|
|
0.08 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Liver and thyroid toxicant Estrogenic USEPA - possible human carcinogen Endocrine issues - Estrogenic effect |
|
|
|
|
|
No information available |
|
|
Health: H302, H317 Environment: H411 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
triadimefon |
|
|
triadimefon |
|
|
Triadimefon |
|
|
triadimefon |
|
|
triadimefon |
|
|
triadimefon |
|
|
- |
|
|
triadimefon |
|
|
triadimefon |
|
|
triadimefon |
|
|
triadimefon |
|
|
- |