| Thionazin (Ref: AC 18133 ) |
(Also known as: cyanophos; thionazine; zynophos; zinofos; nemaphos) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 Warning: Significant data are missing |
|
|
An obsolete organophosphate soil and foliar nematicide and insecticide |
|
|
Free living and parasitic nematodes; Root maggots; Symphylids; Aphids; Leaf miners; Cabbage root fly |
|
|
Cereals; Cotton; Curcubits; Brassicas; Tomatoes; Peanuts |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₈H₁₃N₂O₃PS |
|
|
CCOP(=S)(OCC)OC1=NC=CN=C1 |
|
|
- |
|
|
IRVDMKJLOCGUBJ-UHFFFAOYSA-N |
|
|
InChI=1S/C8H13N2O3PS/c1-3-11-14(15,12-4-2)13-8-7-9-5-6-10-8/h5-7H,3-4H2,1-2H3 |
|
|
Yes |
|
|
Nematicide, Insecticide |
|
|
Organophosphate insectcide; Organothiophosphate insecticide; Organophosphate nematicide; Organothiophosphate nematicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Cholinesterase inhibitor. |
|
|
297-97-2 |
|
|
206-049-6 |
|
|
182 |
|
|
- |
|
|
9272 |
|
|
015-112-00-5 |
|
|
248.24 |
|
|
O,O-diethyl O-pyrazin-2-yl phosphorothioate |
|
|
O,O-diethyl O-pyrazin-2-yl phosphorothioate |
|
|
O,O-diethyl O-pyrazinyl phosphorothioate |
|
|
Subject to the provisions of the UK Poisons Act 1972 |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Myzus persicae, Trialeurodes vaporariorum |
|
|
Brown coloured liquid |
|
|
|
|
|
|
|
|
- Cynem
- Zinophos
- Nemafos
- Zinofos
|
|
|
Usually supplied as an emulsifiable concentrate or as granules |
|
|
|
|
|
|
|
1140 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
-1.7 |
|
- |
|
|
80 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.74 X 1001 |
Calculated |
- |
|
|
1.24 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.21 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
30 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature DT₅₀ 2-6 wks |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
29 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
3.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2.77 |
R4 R = Peer reviewed scientific publications 4 = Verified data median of 8 species |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.09 |
Rasbora heteromorpha |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
3.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
8.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Toxic; may be fatal if inhaled, swallowed or absorbed through skin |
|
|
|
|
|
Not expected to autoignite; Not highly flammable |
|
|
Health: H300, H310 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
thionazin |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |