| Thifluzamide (Ref: MON 24000) |
(Also known as: RH 130753; RH 0753) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate
 |
Human health Low alert
 Warning: Significant data are missing |
|
|
A carboximide systemic fungicide used for rice and other crops |
|
|
Basidomycetes spp.; Sheath blight; Limb rot; Black scurf |
|
|
Rice; Potatoes; Maize; Peanuts; Cotton; Coffee |
|
|
- |
|
|
Current |
|
|
1997 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Brazil, Mexico, Colombia, Venezuela, Japan, Korea, China, Vietnam |
|
|
None |
|
|
C₁₃H₆Br₂F₆N₂O₂S |
|
|
CC1=NC(=C(S1)C(=O)NC2=C(C=C(C=C2Br)OC(F)(F)F)Br)C(F)(F)F |
|
|
- |
|
|
WOSNCVAPUOFXEH-UHFFFAOYSA-N |
|
|
InChI=1S/C13H6Br2F6N2O2S/c1-4-22-10(12(16,17)18)9(26-4)11(24)23-8-6(14)2-5(3-7(8)15)25-13(19,20)21/h2-3H,1H3,(H,23,24) |
|
|
Yes |
|
|
Fungicide |
|
|
Anilide fungicide; Thiazole fungicide |
|
|
95% |
|
|
- |
|
|
Synthetic |
|
|
Systemic, absorbed by roots and translocated, inhibits succinate dehydrogenase in the tricarboxylic acid cycle |
|
|
130000-40-7 |
|
|
603-378-0 |
|
|
None allocated |
|
|
- |
|
|
86389 |
|
|
No data found |
|
|
528.06 |
|
|
N-[2,6-dibromo-4-(trifluoromethoxy)phenyl]-2-methyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxamide |
|
|
2',6'-dibromo-2-methyl-4'-trifluoromethoxy-4-trifluoromethyl-1,3-thiazole-5-carboxanilide |
|
|
N-(2,6-dibromo-4-(trifluoromethoxy)phenyl)-2-methyl-4-(trifluoromethyl)-5-thiazolecarboxamide |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
7 |
|
|
- |
|
|
Off-white powder |
|
|
|
|
|
- Dow AgroSciences
- Nissan Chemicals
- BOC Sciences
|
|
|
- Greatam
- Jangta
- Pulsor
- Beam Prince
|
|
|
- |
|
|
|
|
|
|
|
7.6 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
178 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
375.9 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
177 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
1.45 X 1004 |
Calculated |
- |
|
|
4.16 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.93 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
11.0 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
| Very weak acid |
|
|
1.01 X 10-06 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1145 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Very persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature DT₅₀ range 992-1298 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
10.2 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 9.1-11.3 days, seedlings & grains of rice, n=2 |
|
|
|
3.7 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Moderately fast |
|
|
- |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Slightly mobile |
|
|
734 |
|
|
Manufacturers published Koc 472-996 mL g⁻¹ (E4) General literature koc range 400-1000 mL g⁻¹ (L3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
3.47 |
Calculated |
High leachability |
|
|
|
6.59 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 6500 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
|
1.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2250 |
E4 E = Manufacturers safety data sheets 4 = Verified data Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1250 |
E4 E = Manufacturers safety data sheets 4 = Verified data Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
E4 E = Manufacturers safety data sheets 4 = Verified data Apis mellifera |
Low |
|
|
51 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.3 |
E4 E = Manufacturers safety data sheets 4 = Verified data Lepomis macrochirus |
Moderate |
|
|
0.31 |
E4 E = Manufacturers safety data sheets 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
1.4 |
E4 E = Manufacturers safety data sheets 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 6500 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
5000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
|
5.0 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
0.014 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
Not compatible with oxidising agents |
|
|
- |
|
|
U (Unlikely to present an acute hazard) |
|
|
- |
|
|
- |
|
|
Shelf-life is 2 years. Store at 0-6 ºC |
|
|
|
|
|
thifluzamide |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
tifluzamid |
|
|
- |
|
|
- |
|
|
- |
|
|
- |