| Tetrachlorvinphos (Ref: SD 8447) |
(Also known as: stirofos; CVMP) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High
 |
Human health High alert: Carcinogen; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An insecticide and acaricide for use against various pests of fruits, vegetables, ornamental plants, forest trees and livestock on agricultural and recreational areas |
|
|
Aphids; Mites; Fleas; Ticks; Thrips; leafhoppers; Spider mites |
|
|
Potatoes; Beets; Cereals; Vegetables including brassicas; Cotton |
|
|
- |
|
|
Current |
|
|
1967, USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
USA; Evidence of use in third world countries |
|
|
Isomeric - exists in both the Z- and E- forms. Technical products are predominately comprised of the Z-stereoisomer. |
|
|
C₁₀H₉Cl₄O₄P |
|
|
COP(=O)(OC)OC(=CCl)C1=CC(=C(C=C1Cl)Cl)Cl |
|
|
COP(=O)(OC)O/C(=C\Cl)/C1=CC(=C(C=C1Cl)Cl)Cl |
|
|
UBCKGWBNUIFUST-YHYXMXQVSA-N |
|
|
InChI=1S/C10H9Cl4O4P/c1-16-19(15,17-2)18-10(5-11)6-3-8(13)9(14)4-7(6)12/h3-5H,1-2H3/b10-5+ |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| tetrachlorvinphos |
Unstated isomer |
 |
|
|
Insecticide, Acaricide, Veterinary substance |
|
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Cholinesterase inhibitor. |
|
|
22248-79-9 |
|
|
213-506-3 |
|
|
265 |
|
|
083701 (Z) / 083702 (E) |
|
|
5284462 |
|
|
No data found |
|
|
365.96 |
|
|
(1Z)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl phosphate |
|
|
(Z)-2-chloro-1-(2,4,5-trichlorophenyl)vinyl dimethyl phosphate |
|
|
(1Z)-2-chloro-1-(2,4,5-trichlorophenyl)ethenyl dimethyl phosphate |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Amblyseius fallacis, Bucculatrix thurberiella, Leptinotarsa decemlineata, Myzus persicae, many others |
|
|
Off-white crsytalline solid |
|
|
|
|
|
- ISK Biosciences
- DuPont
- BASF
- Shell
|
|
|
- Appex
- Rabon
- Gardona
- Ravap
- Gardcide
|
|
|
Available in a wide variety of different formulations including concentrates, granules, powders and inpregnated collars |
|
|
|
|
|
|
|
11.6 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
94 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.39 X 1003 |
Calculated |
- |
|
|
3.53 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.52 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
0.0056 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
|
1.86 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
2 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
4.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 2.0-6.0 days, leaves of 2 field crops, n=2 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
|
900 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.31 |
Calculated |
Low leachability |
|
|
|
7.06 X 10-04 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
Aerobic |
|
|
- |
- |
Aerobic |
|
|
- |
- |
Aerobic |
|
|
- |
- |
Aerobic |
|
|
- |
- |
Aerobic |
|
|
- |
- |
Aerobic |
| Known groundwater metabolites |
|
None
|
|
|
|
|
|
| desmethyltetrachlorvinphos |
- |
Rat (Urine) |
- |
- |
| 2,4,5-trichloroacetophenone |
- |
Plant |
- |
- |
| 1-(2,4,5-trichlorophenyl)-2-chloroethan-1-ol |
- |
Plant |
- |
- |
| 2-chloro-1-(2,4,5-trichlorophenyl)ethanol |
- |
Plant |
- |
- |
| dimethyl phosphate |
- |
Rats (Urine) |
- |
- |
| monomethyl phosphate |
- |
Rats (Urine) |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 4000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
125 |
- |
|
|
- |
- |
- |
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1.37 |
Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 0.43 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
0.002 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 4000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
1500 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
0.85 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
Intraperitoneal LD₅₀ > 5000 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Guinea pig |
- |
| Subcutaneous LD₅₀ > 5000 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
May be absorbed through the skin |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Metabolised and mainly excreted in the urine |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
IARC Group 2B carcinogen; USEPA - probable human carcinogen Kidney and liver toxicant Repeated or prolonged skin contact may cause allergic reactions with susceptible person |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 Highly flammable |
|
|
Health: H302, H312, H332, H341 Environment: H400, H410 |
|
|
III (Slightly hazardous) |
|
|
UN3018 |
|
|
- |
|
|
- |
|
|
|
|
|
tetrachlorvinphos |
|
|
tétrachlorvinphos |
|
|
Tetrachlorvinphos |
|
|
tetrachlorvinphos |
|
|
tetraclorvinfos |
|
|
tetraclorvinfos |
|
|
- |
|
|
tetrachlorwinfos |
|
|
- |
|
|
- |
|
|
tetrachloorvinvos |
|
|
- |