| Terbutryn (Ref: GS 14260) |
(Also known as: terbutryne) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent; GUS: Transition state; Drainflow: Slightly mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity High alert: Bees acute contact ecotoxicity: High
 |
Human health High alert: Endocrine distrupter
 |
|
|
A pre-emergence herbicide used to control some grasses and broad-leaved weeds. Also used to control aquatic algae. Also a pesticide transformation product. |
|
|
Chickweed; Poppies; Blackgrass; Annual meadow grass; Deadnettle; Capeweed; Hedge mustard; Shepherd's purse; Bindweed; Lupins |
|
|
Cereals including wheat, barley, oats, triticale; Sorghum; Sugarcane; Sunflowers; Peas; potatoes |
|
|
- |
|
|
Current |
|
|
1966 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₀H₁₉N₅S |
|
|
CCNC1=NC(=NC(=N1)SC)NC(C)(C)C |
|
|
No data |
|
|
IROINLKCQGIITA-UHFFFAOYSA-N |
|
|
InChI=1S/C10H19N5S/c1-6-11-7-12-8(15-10(2,3)4)14-9(13-7)16-5/h6H2,1-5H3,(H2,11,12,13,14,15 |
|
|
Yes |
|
|
Herbicide |
|
|
Triazine herbicide; Methylthiotriazine herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, absorbed through roots and foliage and translocated. Inhibits photosynthesis (photosystem II). |
|
|
886-50-0 |
|
|
212-950-5 |
|
|
212 |
|
|
080813 |
|
|
13450 |
|
|
No data found |
|
|
241.36 |
|
|
N2-tert-butyl-N4-ethyl-6-(methylsulfanyl)-1,3,5-triazine-2,4-diamine |
|
|
N2-tert-butyl-N4-ethyl-6-methylthio-1,3,5-triazine-2,4-diamine |
|
|
N-(1,1-dimethylethyl)-N'-ethyl-6-(methylthio)-1,3,5-triazine-2,4-diamine |
|
|
Potential groundwater contaminant |
|
|
- |
|
|
C1 |
|
|
5 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White or colourless crystalline powder |
|
|
|
|
|
- Agan
- Scotts
- Ciba Geigy
- Makhteshim Agan
|
|
|
- Igran
- Shortstop
- Plantonit
- Senate
- Terbutrex
|
|
|
Usually formulated as a suspension concentrate, granules or wettable powder |
|
|
|
|
|
|
|
25 |
|
Low |
|
|
220000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 9000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
| 130000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source n-Octanol |
- |
| 220000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
|
|
104 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
4.57 X 1003 |
Calculated |
- |
|
|
3.66 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.12 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
4.3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| Weak base |
|
|
0.13 |
|
Low volatility |
|
|
1.50 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
74 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
|
74 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
|
52 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: DT₅₀ 42 days (DW4); 14-50 days (Q3 lab aerobic) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
0.5 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Fast |
|
|
- |
|
|
|
Stable |
|
Stable |
|
|
Stable pH 5 to pH 9 |
|
|
60 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately fast |
|
|
27 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
Slow |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
|
2432 |
|
|
EU dossier, 2 values 2000 & 2863 mL g⁻¹ |
|
|
|
30.7 |
|
Slightly mobile |
|
|
518 |
|
|
1.10 |
|
|
EU dossier Kf range 4.3-109.9 mL g⁻¹, Kfoc range 392-605 mL g⁻¹, 1/n range 1.01-1.35, Soils=5 |
|
|
- |
|
|
|
|
|
|
|
2.21 |
Calculated |
Transition state |
|
|
|
1.04 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
72.4 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source (Other literature Log BCF range 1.1-1.7 (R3)) |
Low potential |
|
|
0.5 |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
300 |
- |
|
|
- |
- |
- |
|
|
> 4640 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 170 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
0.16 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
High |
|
|
1.22 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 1.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
> 2.66 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.0024 |
Pseudokirchneriella subcapitata |
High |
|
|
0.0016 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Chlorella fusca |
Moderate |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
2.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
USEPA - possible human carcinogen |
|
|
|
|
|
No information available |
|
|
Health: H302, H317, H319, H332 Environment: H400, H410, H413 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
terbutryn |
|
|
terbutryne |
|
|
Terbutryn |
|
|
terbutryn |
|
|
terbutrina |
|
|
terbutrina |
|
|
- |
|
|
terbutryn |
|
|
- |
|
|
terbutrin |
|
|
- |
|
|
- |