| Terbacil (Ref: DPX D732) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Bees acute unknown ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Reproduction/development effects
 |
|
|
A herbicide for control of annual grasses, broad-leaved weeds and some perennial weeds that is used on a range of crops including top fruit, lucerne and some herbs |
|
|
Chickweed; Crabgrass; Henbit; Lambsquarter; Ruegrass; Downy brome; Yellow rocket; Speedwell; Wild mustard |
|
|
Sugarcane; Alfalfa; Fruit including peaches, blackberry, dewberry, loganberry, raspberry; Pecan nuts; Mint herbs including peppermint, spearmint; Asparagus; |
|
|
- |
|
|
Current |
|
|
1966 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₉H₁₃ClN₂O₂ |
|
|
CC1=C(C(=O)N(C(=O)N1)C(C)(C)C)Cl |
|
|
- |
|
|
NBQCNZYJJMBDKY-UHFFFAOYSA-N |
|
|
InChI=1S/C9H13ClN2O2/c1-5-6(10)7(13)12(8(14)11-5)9(2,3)4/h1-4H3,(H,11,14) |
|
|
Yes |
|
|
Herbicide |
|
|
Uracil herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, absorbed mainly through the roots. Inhibits photosynthesis (photosystem II). |
|
|
5902-51-2 |
|
|
227-595-1 |
|
|
272 |
|
|
012701 |
|
|
22188 |
|
|
No data found |
|
|
216.07 |
|
|
3-tert-butyl-5-chloro-6-methylpyrimidine-2,4(1H,3H)-dione |
|
|
3-tert-butyl-5-chloro-6-methyluracil |
|
|
5-chloro-3-(1,1-dimethylethyl)-6-methyl-2,4(1H,3H)-pyrimidinedione |
|
|
- |
|
|
- |
|
|
C1 |
|
|
5 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless crystals |
|
|
|
|
|
- DuPont
- AgNova Technologies
|
|
|
|
|
|
Usually formulated as a wettable powder |
|
|
|
|
|
|
|
710 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
171000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Cyclohexanone |
- |
| 53000 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data Xylene |
- |
|
|
176 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
7.76 X 1001 |
Calculated |
- |
|
|
1.89 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.34 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
9.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.0625 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
1.30 X 10-05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
115 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Persistent |
|
|
120 |
|
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data. Literature states DT₅₀ 50-180 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
C2 C = AGRITOX dataset. Dataset is no longer available. 2 = Unverified data of unknown source |
Stable |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Mobile |
|
|
55 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
4.70 |
Calculated |
High leachability |
|
|
|
3.18 X 1000 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
6 |
Whole fish |
Low potential |
|
|
Not available |
- |
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
|
| 3-tert-butyl-5-acetyl-5-hydroxyhydantoin |
- |
Surface water (Photolysis) |
- |
- |
| 5-chloro-6-methyl-(3',5')-5'-chloro-6'-methyl-5',6'-dihydro-6',2-anhydro-3'-tert -butyluracil |
- |
Surface water (Photolysis |
- |
- |
| 3-tert-butyl-6-methyluracil and 6-chloro-2,3-dihydro-3,3,7-trimethyl-5H-oxazolo (3,2a)-pyrimidine-5-one |
- |
Surface water (Photolysis |
- |
- |
| 5-chloro-6-methyluracil |
- |
Surface water (Photolysis |
- |
- |
| 3-tert-butyl-5-chloro-6-hydroxy-methyluracil |
- |
Surface water (Photolysis |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Low |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
250 |
- |
|
|
- |
- |
- |
|
|
> 2250 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Phasianidae |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 193 |
Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
> 50 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 46.2 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
1.2 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Oncorhynchus mykiss growth |
Moderate |
|
|
> 65 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
0.05 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.14 |
Lemna gibba |
Moderate |
|
|
0.042 |
D4 D = Agricultural Research Information System (ARIS) Database. Dataset is no longer available. 4 = Verified data Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
4.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Large doses may cause pallor and rapid breathing |
|
|
|
|
|
IMDG Transport Hazard Class 9 |
|
|
Health: H302 Environment: H400, H410 |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
terbacil |
|
|
terbacile |
|
|
Terbacil |
|
|
terbacil |
|
|
terbacil |
|
|
terbacilo |
|
|
- |
|
|
terbacil |
|
|
- |
|
|
- |
|
|
- |
|
|
- |