| Tebuthiuron (Ref: EL 103) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Persistent; GUS: High leachability
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Reproduction/development effects
 |
|
|
A herbicide used to control a broad range of herbaceous, woody, annual and perennial weeds in non-cropland areas, rights-of-way, and industrial sites |
|
|
Bluegrass; Chickweed; Clover; Docks; Virginia creeper; Whitethorn; Eastern cottonwood; Chamise; Blackberry; Black higory; Bitternut hickory |
|
|
Non-crop areas such as paths; roads, right-of-way, industrial sites |
|
|
- |
|
|
Current |
|
|
1975, Brazil |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₉H₁₆N₄OS |
|
|
CC(C)(C)C1=NN=C(S1)N(C)C(=O)NC |
|
|
- |
|
|
HBPDKDSFLXWOAE-UHFFFAOYSA-N |
|
|
InChI=1S/C9H16N4OS/c1-9(2,3)6-11-12-8(15-6)13(5)7(14)10-4/h1-5H3,(H,10,14) |
|
|
Yes |
|
|
Herbicide |
|
|
Urea herbicide; Thiadiazolylurea herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic, low selectivity, absorbed by roots and translocated. Inhibits photosynthesis (photosystem II). |
|
|
34014-18-1 |
|
|
251-793-7 |
|
|
- |
|
|
105501 |
|
|
5383 |
|
|
616-020-00-3 |
|
|
228.31 |
|
|
N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-N,N'-dimethylurea |
|
|
1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea |
|
|
N-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N'-dimethylurea |
|
|
Potential groundwater contaminant |
|
|
- |
|
|
C2 |
|
|
7 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Off-white to buff coloured crystalline solid |
|
|
|
|
|
|
|
|
- Brush
- Bullet
- Graslan
- Herbic
- Reclaim
- Perflan
- Spike
|
|
|
Usually supplied as wettable powders, granules or pellets |
|
|
|
|
|
|
|
2500 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
3700 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| 6100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
| 70000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 170000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
|
|
162.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
275 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
6.17 X 1001 |
Calculated |
- |
|
|
1.79 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.19 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
0.27 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
2.47 X 10-05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
400 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Very persistent |
|
|
360 |
|
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature data. Other sources: 1300 days at 25 °C (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
64 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately persistent |
|
|
Not sensitive to pH |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Moderately mobile |
|
|
80 |
|
|
Other data: Log Koc 2.1 at 25 °C (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
5.36 |
Calculated |
High leachability |
|
|
|
8.52 X 1000 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
2.6 |
Whole fish |
Low potential |
|
|
Not available |
- |
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
|
| N-(5-[1,1-dimethylethyl]-1,3,4-thiadazol-2-yl)-N'-(hydroxymethyl)-N-methyl urea |
- |
- |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
644 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Moderate |
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
800 |
- |
|
|
- |
- |
- |
|
|
> 2500 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 690 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source in silicon media |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 30 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 87 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
9.3 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas growth |
Moderate |
|
|
> 225 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.135 |
Lemna gibba |
Moderate |
|
|
0.05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
644 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Moderate |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
3.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Moderately toxic Blood, liver, pancreas and kidney toxicant |
|
|
|
|
|
No information available |
|
|
Health: H302 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
tebuthiuron |
|
|
tebuthiuron |
|
|
Tebuthiuron |
|
|
tebuthiuron |
|
|
tebutiuron |
|
|
tebutiuron |
|
|
- |
|
|
tebutiuron |
|
|
- |
|
|
- |
|
|
- |
|
|
- |