| Sulprofos (Ref: NTN 9306) |
(Also known as: mercaprofos; mercaprophos; sulprophos; BAY 123234) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health High alert: Reproduction/development effects; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An obsolete insecticide once used to control small plant-sucking pests |
|
|
Whiteflies; Aphids; Spider mites; Thrips |
|
|
Cotton; Soybeans; Tobacco; Tomatoes; Vegetables; Maize; Peanuts; Lucerne |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1978, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. Substance is racemic. |
|
|
C₁₂H₁₉O₂PS₃ |
|
|
CCCSP(=S)(OCC)OC1=CC=C(C=C1)SC |
|
|
- |
|
|
JXHJNEJVUNHLKO-UHFFFAOYSA-N |
|
|
InChI=1S/C12H19O2PS3/c1-4-10-18-15(16,13-5-2)14-11-6-8-12(17-3)9-7-11/h6-9H,4-5,10H2,1-3H3 |
|
|
Yes |
|
|
Insecticide |
|
|
Organophosphate insecticide; Organothiophosphate insecticdie |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, non-systemic cholinesterase inhibitor |
|
|
35400-43-2 |
|
|
252-545-0 |
|
|
- |
|
|
111501 |
|
|
37125 |
|
|
No data found |
|
|
322.45 |
|
|
(E)-{O-ethyl O-[4-(methylsulfanyl)phenyl] S-propyl phosphorodithioate} |
|
|
(RS)-[O-ethyl O-4-(methylthio)phenyl S-propyl phosphorodithioate] |
|
|
O-ethyl O-(4-(methylthio)phenyl) S-propyl phosphorodithioate |
|
|
Severe Marine Pollutant |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Aphis gossypii, Bemisia tabaci, Heliothis virescens, Spodoptera littoralis |
|
|
Colourless oil |
|
|
|
|
|
|
|
|
|
|
|
Usually formulated as an emulsifiable concentrate |
|
|
|
|
|
|
|
0.31 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
-15 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.02 X 1005 |
Calculated |
- |
|
|
5.48 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.084 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
|
8.70 X 10-02 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
143 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
0.8 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Cotton leaves, n=1 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Non-mobile |
|
|
25900 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
-0.89 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
9078 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
High potential |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
|
|
|
|
|
|
| sulprofos oxon |
- |
Animal |
- |
- |
| sulprofos oxon sulfoxide |
- |
Animal |
- |
- |
| sulprofos oxon sulfone |
- |
Animal |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
176 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
6 |
- |
|
|
- |
- |
- |
|
|
47 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 7.22 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 11 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
|
- |
- |
- |
|
|
> 0.00083 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
91 |
Lemna minor 9 day |
Low |
|
|
64 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Raphidocelis subcapitata |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
176 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
1064 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
4.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H302, H312 Environment: H411 |
|
|
Not classified: Obsolete |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
sulprofos |
|
|
sulprofos |
|
|
Sulprofos |
|
|
sulprofos |
|
|
sulprofos |
|
|
sulprofos |
|
|
- |
|
|
sulprofos |
|
|
- |
|
|
- |
|
|
- |
|
|
- |