| Sulfotep (Ref: ENT 16273) |
(Also known as: sulfotepp; dithio; dithione; thiotep; TEDP) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An insecticide and acaracide fumigant used to control chewing and sucking insects. It is also an impurity of chlorpyrifos. |
|
|
Aphids; Thrips; Spider mites; Whiteflies |
|
|
Greenhouses |
|
|
- |
|
|
- |
|
|
1945 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₈H₂₀O₅P₂S₂ |
|
|
CCOP(=S)(OCC)OP(=S)(OCC)OCC |
|
|
- |
|
|
XIUROWKZWPIAIB-UHFFFAOYSA-N |
|
|
InChI=1S/C8H20O5P2S2/c1-5-9-14(16,10-6-2)13-15(17,11-7-3)12-8-4/h5-8H2,1-4H3 |
|
|
Yes |
|
|
Insecticide, Acaricide |
|
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic with contact and respiratory action. Inhibitor of cholinesterase |
|
|
3689-24-5 |
|
|
222-995-2 |
|
|
198 |
|
|
079501 |
|
|
19395 |
|
|
015-027-00-3 |
|
|
322.32 |
|
|
O1,O1,O3,O3-tetraethyl 1,3-dithiodiphosphate |
|
|
O,O,O',O'-tetraethyl dithiopyrophosphate |
|
|
thiodiphosphoric acid (((HO)2P(S))2O) tetraethyl ester |
|
|
Marine Pollutant |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Myzus persicae, Tetranychus urticae, Trialeurodes vaporariorum |
|
|
Pale yellow liquid |
|
|
|
|
|
|
|
|
|
|
|
Usually used as a fumigant |
|
|
|
|
|
|
|
10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
Miscible |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Acetone |
- |
| Miscible |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Xylene |
- |
| Miscible |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Methanol |
- |
|
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
9.77 X 1003 |
Calculated |
- |
|
|
3.99 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
14 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
|
4.50 X 10-01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
28 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature DT₅₀ range 14-42 days (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
1.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.0-2.0 days, leaves from 2 field grown crops, n=2 |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
|
8.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
pH sensitive: DT₅₀ 10.7 days at pH 4, 9.1 days at pH 9, all at 22 °C |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
|
740 |
|
|
Literature values give Koc between 600 and 5000 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.64 |
Calculated |
Low leachability |
|
|
|
4.43 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
|
|
|
|
|
|
| O,O-diethyl phosphorothioate |
- |
Plant; Rat (Urine) |
- |
- |
| diethyl phosphate |
- |
Plant |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
5.0 |
Rat |
High |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
10 |
- |
|
|
- |
- |
- |
|
|
> 25 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Gallus domesticus |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.00361 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
|
- |
- |
- |
|
|
0.002 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 7.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
5.0 |
Rat |
High |
|
|
65.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
0.05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat (aerosol) |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Health: H310, H300 Environment: H400 |
|
|
Ia (Extremely hazardous) |
|
|
UN1704 |
|
|
Packaging Group II (moderate danger) |
|
|
- |
|
|
|
|
|
sulfotep |
|
|
sulfotep |
|
|
Sulfotep |
|
|
sulfotep |
|
|
sulfotep |
|
|
sulfotep |
|
|
sulfotep |
|
|
sulfotep |
|
|
sulfotep |
|
|
sulfotep |
|
|
sulfotep |
|
|
- |