| Sulfentrazone (Ref: FMC 97285) |
(Also known as: F6285) |
| Sulfentrazone is a herbicide for the control of broad-leaved weeds and some grass species. It has a high aqueous solubility, is volatile and, based on its chemical properties, is mobile with a high potential to leach to groundwater. It can be very persistent in soil and aquatic systems. It is not susceptible to hydrolysis but may degrade via photolysis in aquatic systems. It has a relatively low mammalian toxicity but may bioaccumulate. Whilst its toxicity to birds is relatively low there is greater risk to aquatic species and honey bees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Very persistent; GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Reproduction/development effects
 |
|
|
A herbicide for control of broad-leaved weed and some grasses |
|
|
Carpetweed; Crabgrass; Daisy; Dock; Lambsquarter; Morning glory; Pigweed; Thistles; Waterhemp |
|
|
Soybeans; Chickpeas; Tobacco; Sugarcane; Non-agricultrual areas including highways, roads, fence rows, storage areas, industrial sites |
|
|
- |
|
|
Current |
|
|
1991 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₁H₁₀Cl₂F₂N₄O₃S |
|
|
CC1=NN(C(=O)N1C(F)F)C2=CC(=C(C=C2Cl)Cl)NS(=O)(=O)C |
|
|
- |
|
|
OORLZFUTLGXMEF-UHFFFAOYSA-N |
|
|
InChI=1S/C11H10Cl2F2N4O3S/c1-5-16-19(11(20)18(5)10(14)15)9-4-8(17-23(2,21)22)6(12)3-7(9)13/h3-4,10,17H,1-2H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Anilide herbicide; Triazolone herbicide |
|
|
>92.55% |
|
|
- |
|
|
Synthetic |
|
|
Absorbed by roots and foliage and translocated. Cell membrane disruption - PPO inhibitor. |
|
|
122836-35-5 |
|
|
602-896-4 |
|
|
None allocated |
|
|
129081 |
|
|
86369 |
|
|
No data found |
|
|
387.19 |
|
|
N-{2,4-dichloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]phenyl}methanesulfonamide |
|
|
2',4'-dichloro-5'-(4-difluoromethyl-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl)methanesulfonanilide |
|
|
N-[2,4-dichloro-5-[4-(difluoromethyl)-4,5-dihydro-3-methyl-5-oxo-1H-1,2,4-triazol-1-yl]phenyl]methanesulfonamide |
|
|
Possible groundwater contaminant |
|
|
- |
|
|
E |
|
|
14 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Light tan coloured solid forumated as an off-white liquid with faint odour |
|
|
|
|
|
|
|
|
- Authority 480
- Sulfentrazone 4F Row
|
|
|
Available in a variety of formulations including flowable liquid end-use products and water dispersible granules. |
|
|
|
|
|
|
|
780 |
|
High |
|
|
640000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Acetone |
- |
| 186000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Acetonitrile |
- |
| 66600 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Toluene |
- |
| 110 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Hexane |
- |
|
|
122 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
9.79 X 1000 |
Calculated |
- |
|
|
0.991 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.53 |
|
- |
|
|
6.56 |
|
- |
| Weak acid |
|
|
1.30 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
Max @ 110nm |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
541 |
|
Very persistent |
|
|
400 |
|
Very persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: DT₅₀ circa 18 months (L3); Other literature 121-302 days (Q3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
|
Stable |
|
|
Unstable in UV light |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
Stable under normal environmental conditions |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Mobile |
|
|
43 |
|
|
Other sources: 104 mL g⁻¹ (US3, DW3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
6.16 |
Calculated |
High leachability |
|
|
|
2.41 X 1001 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
Low risk |
Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2855 |
Rat |
Low |
|
|
|
10 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2250 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 25.1 |
|
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
93.8 |
Lepomis macrochirus |
Moderate |
|
|
2.95 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
> 60.4 |
Daphnia magna |
Moderate |
|
|
0.2 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna survival |
Moderate |
|
|
0.800 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.29 |
Lemna gibba |
Moderate |
|
|
32.8 |
Anabaena flos-aquae |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2855 |
Rat |
Low |
|
|
2000 |
Rat |
- |
|
|
> 4.13 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Moderately toxic through the oral route, less so via dermal exposure Possible liver and kideny toxicant |
|
|
|
|
|
Thermal decomposition and burning may form toxic by-products Slightly combustible |
|
|
Health: H332, H373 Environment: H411 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
sulfentrazone |
|
|
sulfentrazone |
|
|
Sulfentrazon |
|
|
sulfentrazon |
|
|
sulfentrazone |
|
|
sulfentrazona |
|
|
- |
|
|
sulfentrazon |
|
|
- |
|
|
- |
|
|
- |
|
|
- |