| Sodium lignosulfonate |
(Also known as: sodium lignosulphonate; sodium polignate ) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Low alert: Fish acute ecotoxicity: Low
 Warning: Significant data are missing |
Human health High alert: Neurotoxicant
 |
|
|
Substance with no pesticidal activity but sometimes used as a dispersant in wettable powder formulations or as a binder for seed treatment coatings. |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not applicable - not a ppp. May be authorised at national level under different legislation |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Isomeric |
|
|
- |
|
|
COC1=CC=CC(=C1O)CC(CS(=O)(=O)[O-])OC2=C(C=C(C=C2)CCCS(=O)(=O)[O-])OC.[Na+].[Na+] |
|
|
COC1=CC=CC(=C1O)C[C@H](CS(=O)(=O)[O-])OC2=C(C=C(C=C2)CCCS(=O)(=O)[O-])OC.[Na+].[Na+] |
|
|
YDEXUEFDPVHGHE-GGMCWBHBSA-L |
|
|
InChI=1S/C20H26O10S2.2Na/c1-28-18-7-3-6-15(20(18)21)12-16(13-32(25,26)27)30-17-9-8-14(11-19(17)29-2)5-4-10-31(22,23)24;;/h3,6-9,11,16,21H,4-5,10,12-13H2,1-2H3,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2/t16-;;/m1../s1 |
|
|
No |
|
|
Other substance, Adjuvant |
|
|
Dispersant, Binder |
|
|
Lignin |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inert substance, enzyme inhibitor |
|
|
8061-51-6 |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
10000 (variable up to 100,000) |
|
|
- |
|
|
disodium;(2R)-3-(2-hydroxy-3-methoxyphenyl)-2-[2-methoxy-4-(3-sulfonatopropyl)phenoxy]propane-1-sulfonate |
|
|
lignosulfonic acid, sodium salt |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Tan coloured solid |
|
|
|
|
|
- Dow AgroSciences
- Rohm and Haas
|
|
|
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.5 |
E2 E = Manufacturers safety data sheets 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 6030 |
E4 E = Manufacturers safety data sheets 4 = Verified data Mouse |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
7300 |
Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 6030 |
E4 E = Manufacturers safety data sheets 4 = Verified data Mouse |
Low |
|
|
- |
- |
- |
|
|
> 0.48 |
V2 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 2 = Unverified data of unknown source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Liver, kidney and blood toxicant |
|
|
|
|
|
Prevent generation of dust |
|
|
- |
|
|
None - not a ppp |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
sodium lignosulfonate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |