| Sethoxydim (Ref: BAS 9052H) |
(Also known as: sethoxydime; cyethoxydim; NP 55) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Low alert
 |
|
|
A post-emergence, selective, annual and perennial grass weed herbicide |
|
|
Barnyardgrass; Crabgrass; Cupgrass; Foxtail; Tall fescue; Johnsongrass; Junglerice; Tame oats; Itchgrass; Volunteer cereals; Stinkgrass |
|
|
Alfalfa; Citrus; Sorghum; Corn; Small grains; Rice; Ornamental grass; Oilseed rape; Sugarbeet; Vegetables |
|
|
- |
|
|
Current |
|
|
1983, Introduced USA |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule with unspecified sterochemistry |
|
|
C₁₇H₂₉NO₃S |
|
|
CCCC(=C1C(=O)CC(CC1=O)CC(C)SCC)NOCC |
|
|
- |
|
|
CSPPKDPQLUUTND-UHFFFAOYSA-N |
|
|
InChI=1S/C17H29NO3S/c1-5-8-14(18-21-6-2)17-15(19)10-13(11-16(17)20)9-12(4)22-7-3/h12-13,19H,5-11H2,1-4H3/b18-14+ |
|
|
Yes |
|
|
Herbicide |
|
|
Cyclohexene herbicide; Cyclohexene oxime herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, systemic absorbed mainly by foliage. An acetyl CoA carboxylase inhibitor (ACCase). |
|
|
74051-80-2 |
|
|
277-682-3 |
|
|
401 |
|
|
121001 |
|
|
52923 |
|
|
No data found |
|
|
327.48 |
|
|
(5E)-2-[(1E)-N-ethoxybutanimidoyl]-5-[(2E)-2-(ethylsulfanyl)propyl]-3-hydroxycyclohex-2-en-1-one |
|
|
(5RS)-2-[(EZ)-1-(ethoxyimino)butyl]-5-[(2RS)-2-(ethylthio)propyl]-3-hydroxycyclohex-2-en-1-one |
|
|
2-(1-(ethoxyimino)butyl)-5-(2-(ethylthio)propyl)-3-hydroxy-2-cyclohexen-1-one |
|
|
- |
|
|
- |
|
|
A |
|
|
1 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Many recorded cases, Alopecurus myosuroides, Avena fatua, Avena sterilis, Avena sterilis ludoviciana, Digitaria sanguinalis |
|
|
Oily amber liquid |
|
|
|
|
|
- BASF
- Bayer CropScience
- Nippon Soda
|
|
|
- Conclude
- Headline G
- Poast
- NABU
|
|
|
Usually supplied as an emulsifiable concentrate. |
|
|
|
|
|
|
|
4700 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
- |
- |
- |
|
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
4.47 X 1001 |
Calculated |
- |
|
|
1.65 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.043 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
4.58 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.013 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
1.39 X 10-06 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1.2 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
|
1 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
|
5 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: DT₅₀ 5-25 days (Q3), 1 day sandy soils (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
0.04 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Navy bean leaves, n=1 |
|
|
|
0.02 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
|
- |
|
|
|
242 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
Persistent |
|
|
- |
|
|
130 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Slow |
|
|
17.8 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
Slow |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Moderately mobile |
|
|
75 |
|
|
Literature values indicate little adsorption with values typicaly between 50 and 100 ml/g |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.49 |
Calculated |
Low leachability |
|
|
|
4.15 X 10-03 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
22.5 |
Whole fish |
Low potential |
|
|
Not available |
- |
|
|
|
|
|
|
|
Major fraction |
0.560 |
- |
|
|
Major fraction |
0.190 |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
2676 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
17.2 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Coturnix japonica |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 542 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 10 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Harmless at dose 3160 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Moderately harmful at dose 3160 g ha⁻¹ |
AA3 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 3 = Unverified data of known source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 170 |
Oncorhynchus mykiss |
Low |
|
|
0.18 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Lepomis macrochirus 4 day |
Moderate |
|
|
> 1.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
> 0.700 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.28 |
Lemna gibba |
Moderate |
|
|
0.64 |
D4 D = Agricultural Research Information System (ARIS) Database. Dataset is no longer available. 4 = Verified data Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
2676 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
6.28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
May be absorbed through the skin |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
GB MRL levels for some commodities subject to change in late 2021 |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Possible thyroid, liver and bone marrow toxicant May cause lung damage if swallowed |
|
|
|
|
|
No information available |
|
|
Not classified: Obsolete |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
sethoxydim |
|
|
séthoxydime |
|
|
Sethoxydim |
|
|
sethoxydim |
|
|
setossidim |
|
|
setoxidim |
|
|
- |
|
|
setoksydim |
|
|
- |
|
|
- |
|
|
setoxidim |
|
|
- |