| Quinclorac (Ref: BAS 514H) |
(Also known as: facet; quinchlorac) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Very persistent; GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Daphnia acute ecotoxicity: Moderate
 |
Human health Moderate alert: Neurotoxicant
 |
|
|
A herbicide used for post-emergence weed control on grass and turf |
|
|
Crabgrass; Barnyard grass; Foxtail; Clover; Dollarweed; Morning glory; Wild violet; Speedwell; Daisy; Black medic |
|
|
Rice; Ornamental grass |
|
|
- |
|
|
Current |
|
|
1989, Spain and Korea |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₀H₅Cl₂NO₂ |
|
|
C1=CC(=C(C2=NC=C(C=C21)Cl)C(=O)O)Cl |
|
|
No data |
|
|
FFSSWMQPCJRCRV-UHFFFAOYSA-N |
|
|
InChI=1S/C10H5Cl2NO2/c11-6-3-5-1-2-7(12)8(10(14)15)9(5)13-4-6/h1-4H,(H,14,15) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| quinclorac |
- |
 |
|
|
Herbicide |
|
|
Quinolinecarboxylic acid herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Absorbed through foliage. Auxin activity. Inhibition of cell wall synthesis. |
|
|
84087-01-4 |
|
|
402-780-1 |
|
|
493 |
|
|
128974 |
|
|
91739 |
|
|
No data found |
|
|
242.06 |
|
|
3,7-dichloroquinoline-8-carboxylic acid |
|
|
3,7-dichloroquinoline-8-carboxylic acid |
|
|
3,7-dichloro-8-quinolinecarboxylic acid |
|
|
- |
|
|
- |
|
|
O |
|
|
4 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Colourless crystals |
|
|
|
|
|
|
|
|
|
|
|
- Basagran Pi
- Pilarfast
- Facet-P
- Paramount
|
|
|
Available in a variety of formulations including dry flowables, granulules, suspension concentrates and wettable powders. |
|
|
|
|
|
|
|
0.065 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
10000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| Insoluble |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Methanol |
- |
| Insoluble |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Xylene |
- |
|
|
274 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
7.08 X 10-02 |
Calculated |
- |
|
|
-1.15 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.75 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
4.34 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.01 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
3.72 X 10-02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
450 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Very persistent |
|
|
540.5 |
|
Very persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data in general literature; US sources: DT₅₀ 168-913 days (US3, DW4) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
3.8 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Tomato fruit, n=1 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Mobile |
|
|
50 |
|
|
Other sources: 13-54 mL g⁻¹ (US3, DW3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
6.29 |
Calculated |
High leachability |
|
|
|
2.96 X 1001 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
0.8 |
Whole fish |
Low potential |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
2680 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
181 |
|
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
> 29.8 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
> 50.4 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.5 |
Lemna gibba |
Moderate |
|
|
6.53 |
Scenedesmus acutus |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
2680 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
5.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Toxic Possible liver and kidney toxicant |
|
|
|
|
|
No information available |
|
|
Health: H317 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
quinclorac |
|
|
quinclorac |
|
|
Quinclorac |
|
|
quinclorac |
|
|
quinclorac |
|
|
quinclorac |
|
|
- |
|
|
quinclorac |
|
|
chinchlorak |
|
|
quinklorak |
|
|
- |
|
|
- |