| Pyroxasulfone (Ref: KIH-485) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Carcinogen
 Warning: Significant data are missing |
|
|
A selective pre-emergence grass and broad-leaved weed herbicide |
|
|
Foxtail; Nutsedge; Lambsquarters; Velvetleaf; Ragweed; Pigweed |
|
|
Corn; Wheat; Soybean |
|
|
- |
|
|
Current |
|
|
2005 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₂H₁₄F₅N₃O₄S |
|
|
CC1(CC(=NO1)S(=O)(=O)CC2=C(N(N=C2C(F)(F)F)C)OC(F)F)C |
|
|
- |
|
|
CASLETQIYIQFTQ-UHFFFAOYSA-N |
|
|
InChI=1S/C12H14F5N3O4S/c1-11(2)4-7(19-24-11)25(21,22)5-6-8(12(15,16)17)18-20(3)9(6)23-10(13)14/h10H,4-5H2,1-3H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Oxazole herbicide; Pyrzole herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibition of very-long-chain fatty acid elongase (VLCFAE) |
|
|
447399-55-5 |
|
|
800-417-5 |
|
|
- |
|
|
090099 |
|
|
11556910 |
|
|
No data found |
|
|
391.32 |
|
|
3-{[5-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methanesulfonyl}-5,5-dimethyl-4,5-dihydro-1,2-oxazole |
|
|
3-[5-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)pyrazol-4-ylmethylsulfonyl]-4,5-dihydro-5,5-dimethyl-1,2-oxazole |
|
|
3-[[[5-(difluoromethoxy)-1-methyl-3-(trifluoromethyl)-1H-pyrazol-4-yl]methyl]sulfonyl]-4,5-dihydro-5,5-dimethylisoxazole |
|
|
- |
|
|
- |
|
|
K3 |
|
|
15 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White crystalline solid with slight characteristic odour |
|
|
|
|
|
|
|
3.49 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
130.7 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.45 X 1002 |
Calculated |
- |
|
|
2.39 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source at 25 °C |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.600 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
| - |
|
|
2.4 X 10-03 |
E4 E = Manufacturers safety data sheets 4 = Verified data at 25 °C |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
22 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
22 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Manufacters data DT₅₀ field range 16-26 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Moderately mobile |
|
|
223 |
|
|
Manufacturers data Koc range 119-226 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.22 |
Calculated |
Transition state |
|
|
|
8.75 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2250 |
E4 E = Manufacturers safety data sheets 4 = Verified data Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 997 |
E4 E = Manufacturers safety data sheets 4 = Verified data Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 2.2 |
E4 E = Manufacturers safety data sheets 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
> 4.4 |
E4 E = Manufacturers safety data sheets 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.00038 |
E4 E = Manufacturers safety data sheets 4 = Verified data Pseudokirchneriella subcapitata |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
|
> 6.56 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Possible liver, urinary bladder and cadiovascular toxicant USEPA - possible human carcinogen at high doses |
|
|
|
|
|
No information available |
|
|
None allocated at this time |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
pyroxasulfone |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |