| Pyriftalid (Ref: CGA 279233) |
(Not known by any other names) |
| Pyriftalid is a rice herbicide. It has a low aqueous solubility and is semi-volatile. Whilst data is sparse it indicates that the chemical is not persistent in soil systems. It has a low mammalian toxicity and has a high potential for bioaccumulation. It is moderately toxic to birds, fish and honey bees. However, it poses a more serious risk to aquatic invertebrates. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High
 |
Human health Low alert
 Warning: Significant data are missing |
|
|
Broad spectrum herbicide used to control grass weeds in rice |
|
|
Barnyard grass; Red sprangle top; Ischaemum rugosum |
|
|
Rice |
|
|
- |
|
|
- |
|
|
2000 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Pyriftalid is a chiral molecule and the technical material is an isomeric mixture. |
|
|
C₁₅H₁₄N₂O₄S |
|
|
CC1C2=C(C(=CC=C2)SC3=NC(=CC(=N3)OC)OC)C(=O)O1 |
|
|
No data |
|
|
RRKHIAYNPVQKEF-UHFFFAOYSA-N |
|
|
InChI=1S/C15H14N2O4S/c1-8-9-5-4-6-10(13(9)14(18)21-8)22-15-16-11(19-2)7-12(17-15)20-3/h4-8H,1-3H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Unclassified herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Taken up mainly by roots. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS. |
|
|
135186-78-6 |
|
|
603-904-9 |
|
|
None allocated |
|
|
- |
|
|
9948894 |
|
|
No data found |
|
|
318.4 |
|
|
rac-(3R)-7-[(4,6-dimethoxypyrimidin-2-yl)sulfanyl]-3-methyl-2-benzofuran-1(3H)-one |
|
|
RS)-7-(4,6-dimethoxypyrimidin-2-ylthio)-3-methyl-2-benzofuran-1(3H)-one |
|
|
7-[(4,6-dimethoxy-2-pyrimidinyl)thio]-3-methyl-1(3H)-isobenzofuranone |
|
|
- |
|
|
- |
|
|
B |
|
|
2 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White, odourless solid |
|
|
|
|
|
|
|
1.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
163.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.98 X 1002 |
Calculated |
- |
|
|
2.6 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.44 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
2.2 X 10-05 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
12.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Literature DT₅₀ range 5-20 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 1505 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
81 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
0.00083 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
82.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Low |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
5.54 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H373 Environment: H411 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
pyriftalid |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |