| Pyrazosulfuron-ethyl (Ref: NC 311) |
(Also known as: Agreen; pyrazosulphuron-ethyl) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Bees acute contact ecotoxicity: Moderate
 |
Human health Low alert
 Warning: Significant data are missing |
|
|
Mainly used to control broad-leaved weeds, grasses and sedges in rice |
|
|
Barnyard grass; Tidalmarsh flatsedge (Cyperus serotinus); Jungle rice (Echinochloa colona) |
|
|
Rice |
|
|
- |
|
|
Current |
|
|
1989, first reported; 1990, first introduced |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Netherlands |
|
|
Expired |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₄H₁₈N₆O₇S |
|
|
CCOC(=O)C1=C(N(N=C1)C)S(=O)(=O)NC(=O)NC2=NC(=CC(=N2)OC)OC |
|
|
- |
|
|
BGNQYGRXEXDAIQ-UHFFFAOYSA-N |
|
|
InChI=1S/C14H18N6O7S/c1-5-27-12(21)8-7-15-20(2)11(8)28(23,24)19-14(22)18-13-16-9(25-3)6-10(17-13)26-4/h6-7H,5H2,1-4H3,(H2,16,17,18,19,22) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| pyrazosulfuron-ethyl |
- |
 |
|
|
Herbicide |
|
|
Sulfonylurea herbicide; Pyrazole herbicide; Pirimidinylsulfonylurea herbicide; Urea herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Broad-spectrum activity, absorbed by roots and translocated through out plant by controlling the synthesis of amino acids. Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
|
|
93697-74-6 |
|
|
618-964-1 |
|
|
None allocated |
|
|
- |
|
|
91750 |
|
|
No data found |
|
|
414.29 |
|
|
ethyl 5-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-1-methyl-1H-pyrazole-4-carboxylate |
|
|
ethyl 5-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-1-methylpyrazole-4-carboxylate |
|
|
ethyl 5-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-1-methyl-1H-pyrazole-4-carboxylate |
|
|
- |
|
|
- |
|
|
B |
|
|
2 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Bacopa rotundifolia, Cyperus difformis |
|
|
Greyish white crystalline solid |
|
|
|
|
|
|
|
|
- Nissan Chemicals
- King Tech Corp
|
|
|
- Sirius 70 WG
- Sideral
- Saathi
- Act
- Sunwell
|
|
|
Usually supplied as wettage granules, suspension concentrates and wettable powders |
|
|
|
|
|
|
|
14.5 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
Low |
|
|
200 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Hexane |
- |
| 15600 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Benzene |
- |
| 31780 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Acetone |
- |
| 234400 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Chloroform |
- |
|
|
181.5 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.45 X 1003 |
Calculated |
- |
|
|
3.16 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.55 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
3.7 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.0147 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
15 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data DT₅₀ 10-28 days, 15 days (P3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately mobile |
|
|
154 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.13 |
Calculated |
Transition state |
|
|
|
6.41 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Mouse |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2250 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
8000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
100 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
180.0 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
700 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
150 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Scenedesmus acutus |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Mouse |
Low |
|
|
2000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rat |
- |
|
|
3.9 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
- |
|
|
U (Unlikely to present an acute hazard) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
pyrazosulfuron-ethyl |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
pirazosulfuron etylowy |
|
|
- |
|
|
- |
|
|
- |
|
|
- |