| Pyrazophos (Ref: HOE 2873) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Slightly mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 Warning: Significant data are missing |
|
|
A fungicide used to control Erysiphe, Helminthosporium and Rhynchospium spp. in cereals and other crops |
|
|
Powdery mildew |
|
|
Cereals; Vegetables including curcubits, brassicas, egg plants; Hops; Some fruit including apples, apricots, citrus, melon; Ornamentals; Cucumber; Tobacco |
|
|
- |
|
|
- |
|
|
circa 1970 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Netherlands |
|
|
Not applicable |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₄H₂₀N₃O₅PS |
|
|
CCOC(=O)C1=CN2C(=CC(=N2)OP(=S)(OCC)OCC)N=C1C |
|
|
No data |
|
|
JOOMJVFZQRQWKR-UHFFFAOYSA-N |
|
|
InChI=1S/C14H20N3O5PS/c1-5-19-14(18)11-9-17-12(15-10(11)4)8-13(16-17)22-23(24,20-6-2)21-7-3/h8-9H,5-7H2,1-4H3 |
|
|
Yes |
|
|
Fungicide |
|
|
Organothiophosphate fungicide; Organophosphate fungicide; |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic with protective and curative action. Phospholipid biosynthesis inhibitor. |
|
|
13457-18-6 |
|
|
236-656-1 |
|
|
350 |
|
|
447500 |
|
|
26033 |
|
|
015-137-00-1 |
|
|
373.36 |
|
|
- |
|
|
ethyl 2-diethoxyphosphinothioyloxy-5-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate |
|
|
ethyl 2-((diethoxyphosphinothioyl)oxy)-5-methylpyrazolo(1,5-a)pyrimidine-6-carboxylate |
|
|
Severe Marine Pollutant; Chemical subject to PIC regulations; PAN listed Highly Hazardous Chemical |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
6 |
|
|
Liriomyza trifolii |
|
|
Colourless to olive brown crystals |
|
|
|
|
|
|
|
|
- Furesan
- Masolon
- Siganex
- Sigma
- Afugan
- Curamil
|
|
|
Usually supplied as an emulsifiable concentrate or wettable powder |
|
|
|
|
|
|
|
4.2 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Low |
|
|
400000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 400000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 400000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
| 16600 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
|
51.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
160 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
34 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source (closed cup) |
- |
|
|
|
6.31 X 1003 |
Calculated |
- |
|
|
3.8 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.35 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.22 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
2.58 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
39 |
W4 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 4 = Verified data |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
3.1 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Published literature RL₅₀ range 2.7-3.5 days, Artichoke heart, n=2 |
|
|
|
11.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 4.5-22.0 days, 3 crops grown undercover or in growth chamber, various matrices, n=3 |
|
|
|
Stable |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Stable |
|
|
- |
|
|
|
41 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
- |
|
|
10 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Slightly mobile |
|
|
646 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.89 |
Calculated |
Transition state |
|
|
|
6.57 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Slightly mobile |
Calculated |
- |
|
|
|
360 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
151 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
5 |
- |
|
|
- |
- |
- |
|
|
118 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Phasianidae |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 0.25 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Apis mellifera |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.48 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
0.00036 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
0.00018 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
65.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
151 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
1.22 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
0.004 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Moderately toxic Harmful |
|
|
|
|
|
IMDG Transport Hazard Class 9 |
|
|
Health: H302, H332 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
Stable and non-reactive under normal conditions of use, storage and transport |
|
|
|
|
|
pyrazophos |
|
|
pyrazophos |
|
|
Pyrazophos |
|
|
pyrazophos |
|
|
pirazofos |
|
|
pirasofos |
|
|
pyrazophos |
|
|
pyrazofos |
|
|
- |
|
|
- |
|
|
pyrazofos |
|
|
- |