| Pyrasulfotole (Ref: AE 0317309 ) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Carcinogen
 |
|
|
A novel herbicide for post-emergent control of various broad-leaved weeds, used with the safener mefenpyr-diethyl |
|
|
Current |
|
|
2004, Australia, Canada, 2007, USA |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
- |
|
|
C₁₄H₁₃F₃N₂O₄S |
|
|
CC1=C(C(=O)N(N1)C)C(=O)C2=C(C=C(C=C2)C(F)(F)F)S(=O)(=O)C |
|
|
No data |
|
|
CZRVDACSCJKRFL-UHFFFAOYSA-N |
|
|
InChI=1S/C14H13F3N2O4S/c1-7-11(13(21)19(2)18-7)12(20)9-5-4-8(14(15,16)17)6-10(9)24(3,22)23/h4-6,21H,1-3H3 |
|
|
Yes |
|
|
Other substance |
|
|
Herbicide safener |
|
|
Pyrazolone |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, acts by the inhibition of carotenoid biosynthesis specifically inhibits the enzyme 4- hydroxyphenylpyruvate dioxygenase (HPPD). |
|
|
365400-11-9 |
|
|
- |
|
|
- |
|
|
000692 |
|
|
- |
|
|
244.3 |
|
|
(5-hydroxy-1,3-dimethyl-1H-pyrazol-4-yl)[2-(methanesulfonyl)-4-(trifluoromethyl)phenyl]methanone |
|
|
(5-hydroxy-1,3-dimethylpyrazol-4-yl)(a,a,a-trifluoro-2-mesyl-p-tolyl)methanone |
|
|
(5-hydroxy-1,3-dimethyl-1H-pyrazol-4-yl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]methanone |
|
|
- |
|
|
- |
|
|
Not known |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Beige coloured powder |
|
|
|
|
|
|
|
|
|
|
69100 |
|
High |
|
|
21600 |
Ethanol |
- |
| 6860 |
Toluene |
- |
| 89200 |
Acetone |
- |
| 37200 |
Ethyl acetate |
- |
|
|
201 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
4.37 X 10-02 |
Calculated |
- |
|
|
-1.36 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.53 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
- |
|
|
4.2 |
|
- |
| Weak acid |
|
|
2.7 X 10-04 |
|
Low volatility |
|
|
- |
- |
- |
|
|
Absoption max at 264nm and 241nm in water, 0.1M HCl, 0.1M NaOH respectively |
|
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
55.5 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
DT₅₀ range 42-16 days and 77-87 days in bare soil and cropped soil, respectively |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
|
Stable |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
365 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source |
Stable |
|
|
140 |
P2 P = Other non-EU, UK or US Governments and Regulators 2 = Unverified data of unknown source |
Stable |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderately mobile |
|
|
368 |
|
|
Koc range 21.6 (clay loam) to 715 (sandy loam) mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.50 |
Calculated |
Transition state |
|
|
|
1.56 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
Low risk |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
Nitrogen mineralisation: No significant adverse effect Carbon mineralisation: No significant adverse effect |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Dose: 0.25 kg ha⁻¹ |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
75.0 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
80.3 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Aphidius rhopalosiphi |
- |
|
|
113 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
93.5 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
|
0.58 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas |
Moderate |
|
|
93.3 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
12.8 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.98 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Lemna gibba |
Moderate |
|
|
30.0 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Low |
|
|
2.6 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Selenastrum capricornutum |
Low |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
Rat |
Low |
|
|
2000 |
Rat |
- |
|
|
> 5.03 |
Rat |
- |
|
|
- |
- |
- |
|
|
0.01 |
Rat SF=100 Australia |
- |
|
|
0.2 |
Rat SF=1000 Australia |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Operators should use full PPE to minimise exposure |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Kidney, urinary bladder & thyroid toxicant May cause serious damage to the eyes USEPA - some evidence to suggest possible human carcinogen |
|
|
|
|
|
No information available |
|
|
- |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
pyrasulfotole |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
pirasulfotol |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |