| Propoxur (Ref: OMS 33) |
(Also known as: arprocarb; PHC; propotox; ENT 25671) |
| Propoxur is a carbamate pesticide. With a high aqueous solubilty, it has potential for being mobile in groundwaters although it is rarely reported. It is not highly volatile. In some instances it may persist in soil systems. It is highly toxic to humans if it is ingested but not other serious health issues have been identified. There are gaps in information relating to the toxicity of propoxur to biodiversity but based on information that is available it likely to be moderately to highly toxic. . |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Endocrine distrupter
 |
|
|
A insecticide and acaricide active against a wide range of pests especially those that cause damage via sucking and chewing. Also used for flea control on domestic pets. |
|
|
Cockroaches; Flies; Mosquitoes; Fleas; Ticks; Aphids; Leaf hoppers |
|
|
Ornamentals; Lawns & turf; Glasshouse crops including tomatoes & cucumbers |
|
|
- |
|
|
Current |
|
|
1959; first registered in the US in 1963. |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₁H₁₅NO₃ |
|
|
CC(C)OC1=CC=CC=C1OC(=O)NC |
|
|
- |
|
|
ISRUGXGCCGIOQO-UHFFFAOYSA-N |
|
|
InChI=1S/C11H15NO3/c1-8(2)14-9-6-4-5-7-10(9)15-11(13)12-3/h4-8H,1-3H3,(H,12,13) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| propoxur |
- |
 |
|
|
Insecticide, Acaricide, Veterinary substance |
|
|
Carbamate insecticide; Carbamate acaricide; Phenyl methylcarbamate insecticide; Phenylk methylcarbamate acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic with contact and stomach action. Acetylcholinesterase (AChE) inhibitor. |
|
|
114-26-1 |
|
|
204-043-8 |
|
|
80 |
|
|
047802 |
|
|
4944 |
|
|
006-016-00-4 |
|
|
209.24 |
|
|
- |
|
|
2-isopropoxyphenyl methylcarbamate |
|
|
2-(1-methylethoxy)phenyl methylcarbamate |
|
|
Marine Pollutant |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1A |
|
|
Not applicable |
|
|
Aedes aegypti, Amblyseius potentillae, Anopheles albimanus, Anopheles atroparvus, Anopheles funestus, many others |
|
|
White crystalline solid |
|
|
|
|
|
- Bayer
- Makhteshim-Agan
- Mobay
|
|
|
|
|
|
Often supplied as emulsifiable concentrates, granules, dusts or wettable powders |
|
|
|
|
|
|
|
1800 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
High |
|
|
200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Isopropanol |
- |
| 94000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 1300 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
|
90 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
Decomposes on distillation |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.38 X 1000 |
Calculated |
- |
|
|
0.14 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.18 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
1.3 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Low volatility |
|
|
1.50 X 10-04 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
79 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
|
30 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately persistent |
|
|
28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
0.65 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Leaves of ornamentals grown undercover, n=1 |
|
|
|
0.4 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Beans, leaves, n=1 |
|
|
|
0.01 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
|
- |
|
|
|
180 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
Persistent |
|
|
- |
|
|
2 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Mobile |
|
|
30 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
3.65 |
Calculated |
High leachability |
|
|
|
5.62 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
Low risk |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Rapid aquatic degradation |
Low risk |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
|
|
|
|
|
|
| dimethyl propoxus |
- |
Plant |
0.27-0.36 |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
~ 50 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
200 |
- |
|
|
- |
- |
- |
|
|
> 25.9 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Colinus virginianus |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
< 0.112 |
Apis mellifera 24hr |
High |
|
|
- |
- |
- |
|
|
> 1.35 |
|
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
> 1.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data Bombus terrestris |
Moderate |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
6.2 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Lepomis macrochirus |
Moderate |
|
|
- |
- |
- |
|
|
0.15 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
0.016 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna survival 42 day |
Moderate |
|
|
- |
- |
- |
|
|
38.1 |
Chironomus riparius 1 day |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
~ 50 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
> 0.50 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Rat |
- |
|
|
Intraperitoneal LD₅₀ = 30 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
| Intramuscular LD₅₀ = 53 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
0.02 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Absorbed through skin but in humans it is emininated, as its major metabolite 2-isopropoxyphenol (IPP), via urine within 24 hr of application |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
?Possibly, status not identified |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Toxic USEPA - probable human carcinogen Endocrine issues - Weak estrogenic effect |
|
|
|
|
|
IMDG Transport Hazard Class 6,1 |
|
|
Health: H301 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN2757 |
|
|
- |
|
|
- |
|
|
|
|
|
propoxur |
|
|
propoxur |
|
|
Propoxur |
|
|
propoxur |
|
|
propoxur |
|
|
propoxur |
|
|
propoxur |
|
|
propoksur |
|
|
- |
|
|
- |
|
|
propoxur |
|
|
- |