| Propamocarb (Ref: SN 39744) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Non-persistent
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Endocrine distrupter
 |
|
|
A fungicide for specific control of Phycomycetes and effective against Phytophthora spp. and Pythium spp. Normally used as the hydrochloride salt. |
|
|
Late blight; Root rot; Damping off; Downy mildew (Bremia lactucae); Mildew |
|
|
Turf; Ornamentals; Tobacco; Vegetables; Potatoes; Strawberries; Cucumbers; Tomato; Lettuce |
|
|
- |
|
|
Current |
|
|
1978, discovered |
|
|
Approved |
|
|
30/07/2029 |
|
|
Check label - may vary with formulation |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Portugal/Belgium |
|
|
30/07/2023 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
|
|
|
None |
|
|
C₉H₂₀N₂O₂ |
|
|
CCCOC(=O)NCCCN(C)C |
|
|
- |
|
|
WZZLDXDUQPOXNW-UHFFFAOYSA-N |
|
|
InChI=1S/C9H20N2O2/c1-4-8-13-9(12)10-6-5-7-11(2)3/h4-8H2,1-3H3,(H,10,12) |
|
|
Yes |
|
|
Fungicide |
|
|
Carbamate fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic, with protective action absorbed by roots and leaves and translocated. Lipid synthesis inhibitor. |
|
|
24579-73-5 |
|
|
607-406-2 |
|
|
399 |
|
|
119302 |
|
|
32490 |
|
|
No data found |
|
|
188.3 |
|
|
propyl [3-(dimethylamino)propyl]carbamate |
|
|
propyl 3-(dimethylamino)propylcarbamate |
|
|
propyl (3-(dimethylamino)propyl)carbamate |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
28 |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
|
|
|
- Banol
- Tattoo C
- Dynone
- Filex
- Proplant
|
|
|
Usually formulated as an aqueous concentrate using the hydrochloride salt |
|
|
|
|
|
|
|
900000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
883000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
| 933000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 937000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 921000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
100 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
|
6.92 X 1000 |
Calculated |
- |
|
|
0.84 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.963 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
9.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| Strong base |
|
|
730 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
|
1.5 X 10-04 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
14 |
|
Non-persistent |
|
|
14 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
4.75 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
- |
|
|
Cabbage leaves, n=1 |
|
|
|
8.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
RL₅₀ range 8.2-9.1, ginseng root, stems & leaves, n=3 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
as the hydrochloride salt |
Low |
|
|
> 84 |
as the hydrochloride salt |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
500 |
Aphidius rhopalosiphi as hydrochloride salt |
- |
|
|
> 360 |
Typhlodromus pyri as hydrochloride salt |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
96.8 |
Cyprinodon variegatus |
Moderate |
|
|
- |
- |
- |
|
|
106 |
Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
104.7 |
Americamysis bahia |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
301 |
Scenedesmus quadricauda |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.29 |
|
- |
|
|
1.0 |
|
- |
|
|
- |
- |
- |
|
|
0.29 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Possible weak skin sensitiser Endocrine issues - Weak increase of aromatase activity and estrogen production |
|
|
|
|
|
Not flammable or explosive IMDG Transport Hazard Class 6,1 |
|
|
Health: H302 |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN2757 |
|
|
- |
|
|
- |
|
|
|
|
|
propamocarb |
|
|
propamocarbe |
|
|
Propamocarb |
|
|
propamocarb |
|
|
propamocarb |
|
|
propamocarb |
|
|
- |
|
|
chlorowodorek |
|
|
propamokarb |
|
|
propamokarb |
|
|
propamocarb |
|
|
- |