| Prometon (Ref: G 31435) |
(Also known as: prometone; 2,4-prometone) |
| Prometon is a non-selective herbicide. It is highly soluble in water, volatile and, based on its chemical properties, it is highly mobile and has a high potential to leach to groundwater. It can be highly persistent in both soil and aquatic systems. It has a relatively low mammalian toxicity and is not expected to bioaccumulate. It is classified as an irritant. It is moderately toxic to birds, most aquatic species and honey bees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Very persistent; GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute contact ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate
 Warning: Significant data are missing |
|
|
A herbicide for annual and perennial broad-leaved weed, brush and grass control mainly in non-cropping situations. |
|
|
Broad-leaved weeds and grasses including Johsongrass, Bermudagrass, foxtail, crabgrass, docks, goosegrass, nightshade, pigweed |
|
|
Non-cropped areas including paths, around buildings, utility sites |
|
|
- |
|
|
Current |
|
|
circa 1962 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₀H₁₉N₅O |
|
|
CC(C)NC1=NC(=NC(=N1)OC)NC(C)C |
|
|
No data |
|
|
ISEUFVQQFVOBCY-UHFFFAOYSA-N |
|
|
InChI=1S/C10H19N5O/c1-6(2)11-8-13-9(12-7(3)4)15-10(14-8)16-5/h6-7H,1-5H3,(H2,11,12,13,14,15) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| prometon |
- |
 |
|
|
Herbicide |
|
|
Methoxytriazine herbicide; triazine herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-selective, systemic absorbed by foliage and roots, inhibits photosynthesis. Affects photosystem II competing with plastoquinone and modifying electron transport processes. |
|
|
1610-18-0 |
|
|
216-548-0 |
|
|
175 |
|
|
080804 |
|
|
4928 |
|
|
No data found |
|
|
225.3 |
|
|
- |
|
|
N2,N4-diisopropyl-6-methoxy-1,3,5-triazine-2,4-diamine |
|
|
6-methoxy-N,N'-bis(1-methylethyl)-1,3,5-triazine-2,4-diamine |
|
|
Potential groundwater contaminant |
|
|
- |
|
|
C1 |
|
|
5 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
White crystalline powder |
|
|
|
|
|
- Ciba-Geigy Group
- Makhteshim Agan
|
|
|
|
|
|
Usually formulated as emulsifiable concentrates, wettable powders and pellets. Application of sprays or granules can be before or after weed emergence. |
|
|
|
|
|
|
|
620 |
|
High |
|
|
250000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| 500000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| 500000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 250000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
|
|
91.5 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
8.13 X 1002 |
Calculated |
- |
|
|
2.91 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.088 |
|
- |
|
|
9.73 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
- |
| Weak acid |
|
|
0.306 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
4.38 X 10-04 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
500 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Very persistent |
|
|
932 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source at 25 °C |
Very persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Stable |
|
|
General literature states >200 days |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
0.16 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Mobile |
|
|
43.2 |
|
|
Literature data: Kd range 0.15-0.17 mL g⁻¹, koc rnage 34.9-51.5 mL g⁻¹, soils=2; Other sources Log Koc 2.54 at 25 °C (R3) |
|
|
|
0.29 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Moderately mobile |
|
|
75.2 |
|
|
0.918 |
|
|
Literature data: Kf range 0.22-0.36 mL g⁻¹, kfoc range 66.7-83.7 mL g⁻¹, 1/n range 0.872-0.963, Soils=2 |
|
|
- |
|
|
|
|
|
|
|
6.31 |
Calculated |
High leachability |
|
|
|
3.18 X 1001 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
69 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1518 |
Rat |
Moderate |
|
|
|
5.4 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Rat |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
1605 |
Anas platyrhynchos |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
36 |
|
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
12 |
Oncorhynchus mykiss |
Moderate |
|
|
0.999 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas |
Moderate |
|
|
25.7 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.624 |
Lemna gibba |
Moderate |
|
|
> 0.4 |
Pseudokirchneriella subcapitata |
Moderate |
|
|
0.035 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Chlorella fusca 24 hrs |
Moderate |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1518 |
Rat |
Moderate |
|
|
2020 |
Rabbit |
- |
|
|
> 0.52 |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Liver toxicant Harmful if swallowed |
|
|
|
|
|
No information available |
|
|
Health: H302, H315, H319, H335 Environment: H411 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
prometon |
|
|
prometone |
|
|
Prometon |
|
|
prometon |
|
|
prometon |
|
|
prometon |
|
|
- |
|
|
prometon |
|
|
- |
|
|
- |
|
|
- |
|
|
- |