| Profluthrin (Ref: S-1840) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Fish acute ecotoxicity: High
 Warning: Significant data are missing |
Human health High alert: Neurotoxicant
 Warning: Significant data are missing |
|
|
A substances used in mothproofers and which is highly effective against sanitary and fabric pests. It also demonstrates egg-hatching inhibition. |
|
|
Moths including the common clothes moth (Tineola bisselliella), fungus moth (Tinea translucens); Carpet beetle (Attagenus unicolor, Flies; Mosquitoes, Cockroaches |
|
|
Household use |
|
|
- |
|
|
Current |
|
|
2002, first registered; 2004 launched Japan |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Profluthrin is a chiral molecule. Substance is racemic. |
|
|
C₁₇H₁₈F₄O₂ |
|
|
CC=CC1C(C1(C)C)C(=O)OCC2=C(C(=C(C(=C2F)F)C)F)F |
|
|
- |
|
|
AGMMRUPNXPWLGF-UHFFFAOYSA-N |
|
|
InChI=1S/C17H18F4O2/c1-5-6-10-11(17(10,3)4)16(22)23-7-9-14(20)12(18)8(2)13(19)15(9)21/h5-6,10-11H,7H2,1-4H3/b6-5+ |
|
|
Yes |
|
|
Insecticide, Repellent |
|
|
Pyrethroid insecticide; Pyrethroid ester insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Broad spectrum insect control |
|
|
223419-20-3 |
|
|
No data found |
|
|
None allocated |
|
|
- |
|
|
11609617 |
|
|
No data found |
|
|
330.32 |
|
|
(2,3,5,6-tetrafluoro-4-methylphenyl)methyl (1E,3E)-2,2-dimethyl-3-[1(E)-prop-1-en-1-yl]cyclopropane-1-carboxylate |
|
|
2,3,5,6-tetrafluoro-4-methylbenzyl (EZ)-(1RS,3RS;1RS,3SR)-2,2-dimethyl-3-prop-1-enylcyclopropanecarboxylate |
|
|
(2,3,5,6-tetrafluoro-4-methylphenyl)methyl 2,2-dimethyl-3-(1-propen-1-yl)cyclopropanecarboxylate |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
3A |
|
|
Not applicable |
|
|
- |
|
|
Clear yellow liquid with a characteristic odour |
|
|
|
|
|
- Sumotomo Chemical co.
- Valent USA
|
|
|
|
|
|
- |
|
|
|
|
|
|
|
0.16 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
|
Miscible |
R4 R = Peer reviewed scientific publications 4 = Verified data Ethanol |
- |
|
|
25 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
158 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
|
7.94 X 1005 |
Calculated |
- |
|
|
5.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.19 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
- |
- |
- |
| - |
|
|
10.3 |
R4 R = Peer reviewed scientific publications 4 = Verified data at 25°C |
Highly volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.0029 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Cyprinus carpio |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Low |
|
|
2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
|
1.99 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
No data found |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
CNS and liver toxicant May cause tremors and clonic convulsions if ingested |
|
|
|
|
|
No information available |
|
|
- |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
profluthrin |
|
|
profluthrine |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |