| Prochloraz manganese complex (Ref: BTS 46828) |
(Also known as: prochloraz-Mn) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity High alert: Fish chronic ecotoxicity: High
 |
Human health High alert: Carcinogen; Reproduction/development effects
 |
|
|
A prochloraz-metal complex active against a wide range of fungal diseases affecting cereals, field crops, fruit and many other crops. |
|
|
Anthracnose; Dothiorella complex; Stem-end rot; Eyespot |
|
|
Fruit; Field crops; Mushrooms; Turf; Avocados; Mangoes; Cereals including wheat, barley, winter rye, winter oilseed rape |
|
|
Wheat/Eyespot=Moderate; Wheat/Mildew=Low; Wheat/Septoria=Low; Wheat/Rust=Low; Barley/Net blotch=Low |
|
|
Current |
|
|
1977, prochloraz first reported |
|
|
Approved - as prochloraz |
|
|
31/12/2026 |
|
|
Check label - may vary with formulation |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Belgium/Denmark |
|
|
Expired |
|
|
Not applicable |
|
|
Yes (as prochloraz) |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₃₀H₃₂Cl₈MnN₆O₄ |
|
|
CCCN(CCOC1=C(C=C(C=C1Cl)Cl)Cl)C(=O)N2C=CN=C2.CCCN(CCOC1=C(C=C(C=C1Cl)Cl)Cl)C(=O)N2C=CN=C2.Cl[Mn]Cl |
|
|
- |
|
|
CERKEZZZEAJIBS-UHFFFAOYSA-L |
|
|
InChI=1S/2C15H16Cl3N3O2.2ClH.Mn/c2*1-2-4-20(15(22)21-5-3-19-10-21)6-7-23-14-12(17)8-11(16)9-13(14)18;;;/h2*3,5,8-10H,2,4,6-7H2,1H3;2*1H;/q;;;;+2/p-2 |
|
|
Yes |
|
|
Fungicide |
|
|
Amide fungicide; Conazole fungicide; Organometal complex |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Broad-spectrum with protectant and eradicant properties. Disrupts membrane function. |
|
|
69192-23-0 |
|
|
273-907-4 |
|
|
407 |
|
|
- |
|
|
155203 |
|
|
No data found |
|
|
879.18 |
|
|
N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide complex with manganese(II) chloride (2:1) |
|
|
N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]imidazole-1-carboxamide complex with manganese(II) chloride (2:1) |
|
|
dichlorobis[N-propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-imidazole-1-carboxamide-κO1]manganese |
|
|
- |
|
|
UK non-statutory standard for the protection of aquatic life: freshwater and saltwater annual average: 4 ug prochloraz/L; max acceptable conc: 40 ug prochloraz/L |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
3 |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
- |
|
|
- |
|
|
Often supplied as emulsifiable concentrates or wettable powder |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
499.8 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
256.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
|
1.62 X 1003 |
Calculated |
- |
|
|
3.21 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
Not readily biodegradable |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
The manganese complex rapidly dissociates - see prochloraz data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
- |
|
|
- |
|
|
The manganese complex rapidly dissociates - see prochloraz data |
|
|
|
- |
|
- |
|
|
- |
|
|
- |
|
|
The manganese complex rapidly dissociates - see prochloraz data |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1023 |
Rat as prochloraz |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
662 |
Colinus virginianus as prochloraz |
Moderate |
|
|
- |
- |
- |
|
|
33.1 |
Colinus virginianus as prochloraz NOEC |
Moderate |
|
|
> 1000 |
Eisenia foetida as prochloraz |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
141.3 |
Apis mellifera as prochloraz |
Low |
|
|
> 101 |
Apis mellifera as prochloraz |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
> 900 |
Coccinella septempunctata as prochloraz |
- |
|
|
- |
- |
- |
|
|
85.1 |
Aphidius rhopalosiphi as prochloraz |
- |
|
|
44.3 |
Typhlodromus pyri as prochloraz |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.5 |
Oncorhynchus mykiss as prochloraz |
Moderate |
|
|
0.049 |
Pimephales promelas as prochloraz |
Moderate |
|
|
4.3 |
Daphnia magna as prochloraz |
Moderate |
|
|
0.022 |
Daphnia magna as prochloraz |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.171 |
Lemna gibba as prochloraz |
Moderate |
|
|
> 0.0055 |
Scenedesmus subspicatus as prochloraz |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1023 |
Rat as prochloraz |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.01 |
Dog SF=100 as prochloraz |
- |
|
|
0.025 |
Rat SF=100 as prochloraz |
- |
|
|
- |
- |
- |
|
|
0.02 |
Dog SF=100 as prochloraz |
- |
|
|
1.2-3.2 |
concentration dependent |
- |
|
|
- |
- |
- |
|
|
|
No unacceptable risks to bystanders identified |
|
|
No unacceptable risks to operators or other workers identified |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
0.1 |
EU Dir 89/778/EC limit; Calc MAC=30 µg prochloraz/L |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B2 B = DNA damage/repair (EFSA database) 2 = Mixed/ambiguous results ; C3 C = Gene mutation (EFSA database) 3 = Negative ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Possible liver toxicant USEPA - possible human carcinogen Endocrine issues - Activation of Pregnane X cellular receptor |
|
|
|
|
|
Not explosive or oxidising IMDG Transport Hazard Class 9 Not expected to autoignite; Not highly flammable |
|
|
Health: H302 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN3077 |
|
|
Contain/absorb spillage in suitable inert, absorbent material. Transfer to heavy duty plastic drums. Dispose in approved manner Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
prochloraz manganese complex |
|
|
prochloraze-manganèse |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |