| Pirimiphos-ethyl (Ref: PP211) |
(Also known as: pyrimiphos-éthyl) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile; Potential for particle bound transport: Medium
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Fish acute ecotoxicity: High; Daphnia acute ecotoxicity: High
 |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An obsolete pyrimidine organothiophosphate insecticide once used mainly on top fruit |
|
|
Aphids |
|
|
Top fruit including apples, pears; Turf |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
- |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₃H₂₄N₃O₃PS |
|
|
CCN(CC)C1=NC(=CC(=N1)OP(=S)(OCC)OCC)C |
|
|
No data |
|
|
TZBPRYIIJAJUOY-UHFFFAOYSA-N |
|
|
InChI=1S/C13H24N3O3PS/c1-6-16(7-2)13-14-11(5)10-12(15-13)19-20(21,17-8-3)18-9-4/h10H,6-9H2,1-5H3 |
|
|
Yes |
|
|
Insecticide, Acaricide |
|
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide; Pyrimidine insecticide; Pyrimidine acaricide |
|
|
>95% |
|
|
- |
|
|
Synthetic |
|
|
Broad-spectrum with contact and respiratory action. Cholinesterase inhibitor. |
|
|
23505-41-1 |
|
|
245-704-0 |
|
|
492 |
|
|
108101 |
|
|
31957 |
|
|
015-099-00-6 |
|
|
305.34 |
|
|
- |
|
|
O-2-diethylamino-6-methylpyrimidin-4-yl O,O-diethyl phosphorothioate |
|
|
O-[2-(diethylamino)-6-methyl-4-pyrimidinyl] O,O-diethyl phosphorothioate |
|
|
Severe Marine Pollutant; Subject to the provisions of the UK Poisons Act 1972 |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Blissus insularis |
|
|
Sraw coloured liquid |
|
|
|
|
|
|
|
|
|
|
|
Available in a wide variety of different formulations including granules and emulsifiable concentrates |
|
|
|
|
|
|
|
93.0 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
15 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
194 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
>60 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
7.08 X 1004 |
Calculated |
- |
|
|
4.85 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.14 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.68 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
0.452 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
45 |
M4 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 4 = Verified data |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data, literature DT₅₀ studies range 21-70 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
M3 M = GLEAMS Model database (Groundwater Loading Effects of Agricultural Management Systems). Dataset no longer available. 3 = Unverified data of known source |
Moderately mobile |
|
|
300 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.52 |
Calculated |
Transition state |
|
|
|
1.55 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
3000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 140 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
2.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.02 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Salmo trutta |
High |
|
|
- |
- |
- |
|
|
0.0025 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.03 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 140 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
1000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Toxic if swallowed |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Health: H301, H312 Environment: H400, H410 |
|
|
Ib (Highly hazardous) |
|
|
UN3018 |
|
|
- |
|
|
- |
|
|
|
|
|
pirimiphos-ethyl |
|
|
pyrimiphos-ethyl |
|
|
Pirimiphos-ethyl |
|
|
pirimiphos-ethyl |
|
|
pirimifos-etile |
|
|
pirimifos-etil |
|
|
pirimiphos-ethyl |
|
|
pirimifos etylu |
|
|
- |
|
|
- |
|
|
pirimifos-ethyl |
|
|
- |