| Picloram-dimethylammonium |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Low alert: Non-persistent
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate
 |
Human health Low alert
 Warning: Significant data are missing |
|
|
A herbicide which is a variant of picloram, used for the control of broad-leaved weeds on non-crop and utility areas |
|
|
Woody plants; Brush; Broad-leaved weeds including leafy spurge, knapweeds, thistles, toadflax, birdsfood trefoil and hoary cress. Will not control crucifers |
|
|
Non-cropped areas; Rangeland |
|
|
- |
|
|
Current |
|
|
2013 |
|
|
Approved |
|
|
31/12/2029 |
|
|
Check label - may vary with formulation |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Poland/Czech Republic |
|
|
31/12/2023 |
|
|
No |
|
|
Yes - as picloram |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
|
|
|
✓ |
✓ |
✓ |
✓ |
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
|
|
✓ |
|
✓ |
✓ |
✓ |
✓ |
|
|
|
|
|
|
None |
|
|
C₈H₁₀Cl₃N₃O₂ |
|
|
CNC.C1(=C(C(=NC(=C1Cl)Cl)C(=O)O)Cl)N |
|
|
- |
|
|
NPLPNFIMSLUIMN-UHFFFAOYSA-N |
|
|
InChI=1S/C6H3Cl3N2O2.C2H7N/c7-1-3(10)2(8)5(9)11-4(1)6(12)13;1-3-2/h(H2,10,11)(H,12,13);3H,1-2H3 |
|
|
Yes |
|
|
Herbicide |
|
|
Pyridine herbicide; Picolinic acid herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, systemic absorbed by roots and leaves and translocated. Synthetic auxin. |
|
|
55870-98-9 |
|
|
No data found |
|
|
174 |
|
|
- |
|
|
No data |
|
|
No data found |
|
|
286.54 |
|
|
4-amino-3,5,6-trichloropyridine-2-carboxylic acid—N-methylmethanamine (1/1) |
|
|
4-amino-3,5,6-trichloropyridine-2-carboxylic acid - dimethylamine (1:1) |
|
|
4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid compound with N-methylmethanamine (1:1) |
|
|
Marine pollutant |
|
|
- |
|
|
O |
|
|
4 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
|
|
560 |
as picloram |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.20 X 10-02 |
Calculated |
- |
|
|
-1.92 |
as picloram |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
8.0 X 10-05 |
as picloram |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
23.0 |
as picloram |
Non-persistent |
|
|
23.0 |
as picloram |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
4012 |
Rat as picloram |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 1944 |
Anas platyrhynchos as picloram |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
Apis mellifera as picloram |
Low |
|
|
> 74 |
Apis mellifera as picloram |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
8.8 |
Oncorhynchus mykiss as picloram |
Moderate |
|
|
- |
- |
- |
|
|
44.2 |
Daphnia magna as picloram |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
4012 |
Rat as picloram |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.3 |
as picloram |
- |
|
|
0.3 |
as picloram |
- |
|
|
- |
- |
- |
|
|
0.3 |
as picloram |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H319 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
picloram-dimethylammonium |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |