| Phosphamidon (Ref: OMS 1325) |
(Also known as: foszfamidon; famfos; ENT 25515; C 570) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Endocrine distrupter; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An insecticide and nematicide used to control a very wide range of pests including sucking, chewing and boring insects |
|
|
Aphids; Leaf miners; Spruce budworm; Beetles; Thrips; Codling moth; Grasshoppers; Bollworms |
|
|
Rice; Citrus; Nuts; Cotton; Sugarcane; Potatoes; Peas & beans; Strawberries |
|
|
- |
|
|
- |
|
|
circa 1960 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Germany |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Exists in both E- and Z- isomeric forms |
|
|
C₁₀H₁₉ClNO₅P |
|
|
CCN(CC)C(=O)C(=C(C)OP(=O)(OC)OC)Cl |
|
|
CCN(CC)C(=O)/C(=C(\C)/OP(=O)(OC)OC)/Cl |
|
|
RGCLLPNLLBQHPF-UHFFFAOYSA-N |
|
|
InChI=1S/C10H19ClNO5P/c1-6-12(7-2)10(13)9(11)8(3)17-18(14,15-4)16-5/h6-7H2,1-5H3/b9-8- |
|
|
Yes |
|
|
Insecticide, Acaricide |
|
|
Organophosphate insecticide; Organophosphate nematicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Strong stomach action and slight contact action. Cholinesterase inhibitor. |
|
|
13171-21-6 |
|
|
236-116-5 |
|
|
110 |
|
|
018201 |
|
|
3032604 |
|
|
015-022-00-6 |
|
|
299.69 |
|
|
- |
|
|
(EZ)-2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate |
|
|
2-chloro-3-(diethylamino)-1-methyl-3-oxo-1-propenyl dimethyl phosphate |
|
|
Some formulations subject to PIC regulations; Severe Marine Pollutant; Rotterdam Convention (Class Ia); Subject to the provisions of the UK Poisons Act 1972 |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Amblyseius fallacis, Boophilus microplus, Myzus persicae, Phorodon humuli, tetranychus urticae, many others |
|
|
Pale yellow liquid |
|
|
|
|
|
- King Tech Corp
- Syngenta
- United Phosphorus
- Ciba Geigy
|
|
|
- Hawk
- Phosron
- Alfamidon
- KinadonPlus
- Dimecron
|
|
|
Available as a liquid, soluble concentrate and ULV for waterless spraying |
|
|
|
|
|
|
|
1000000 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
High |
|
|
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
|
|
-45 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
6.24 X 1000 |
Calculated |
- |
|
|
0.795 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.21 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
2.93 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Low volatility |
|
|
8.80 X 10-07 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
9.2 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
9 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
12 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Other sources: DT₅₀ 17 days (DW4) |
|
|
|
4.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Orange, various matrices, n=2 |
|
|
|
6.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.0-11.0 days, 5 field crops, various matrices, n=7 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
36 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
|
Other data: DT₅₀ 60 days at pH 5, 54 days at pH 7, 12 days at pH 9, all at 20 °C (L3) |
|
|
13 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Fast |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
H3 H = The US ARS pesticide properties database. Dataset is no longer available. 3 = Unverified data of known source |
Mobile |
|
|
33 |
|
|
Other sources: 7 mL g⁻¹ (DW3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
2.68 |
Calculated |
Transition state |
|
|
|
9.06 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
75 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Estimated |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
7.0 |
Rat |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
3.1 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Anas platyrhynchos |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
0.17 |
Apis mellifera |
High |
|
|
> 1.46 |
R4 R = Peer reviewed scientific publications 4 = Verified data Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
0.0003 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
|
Contact |
|
|
|
0.0054 |
R4 R = Peer reviewed scientific publications 4 = Verified data Nomia melanderi |
High |
|
|
Contact |
|
|
- |
- |
- |
|
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Chrysoperla carnea |
- |
|
|
- |
- |
- |
|
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
6 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
0.008 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Daphnia magna |
High |
|
|
> 0.001 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
High |
|
|
> 0.090 |
Americamysis bahia |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 260 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
7.0 |
Rat |
High |
|
|
267 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
0.033 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
|
- |
- |
- |
|
|
0.0005 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
Readily absorbed from the gastrointestinal tract, through the skin and by inhalation of spray mists and dusts |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Extremely hazardous Mutagenic potential USEPA - possible human carcinogen |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Health: H300, H311, H341 Environment: H400, H410 |
|
|
Ia (Extremely hazardous) |
|
|
UN3018 |
|
|
- |
|
|
- |
|
|
|
|
|
phosphamidon |
|
|
phosphamidon |
|
|
Phosphamidon |
|
|
phosphamidon |
|
|
fosamidone |
|
|
fosfamidon |
|
|
phosphamidon |
|
|
fosfamidon |
|
|
- |
|
|
foszamidon |
|
|
fosfamidon |
|
|
- |