| Peroxyacetic acid |
(Also known as: PAA; ethaneperoxoic acid; acetyl hydroperoxide; peracetic acid) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Drainflow: Very mobile
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen
 |
|
|
A commodity substance used as an agricultural fungicide/nematicide and as a disinfectant for plant protection purposes |
|
|
Algae; Downy mildew; Fusarium root rot; Powdery mildew; Rusts; Scabs; Smuts; Grey moulds |
|
|
Fruit and vegetable storage; Ornamentals; Turf |
|
|
- |
|
|
Current |
|
|
circa 1985, registered as an antimicrobial agent |
|
|
Not approved - not a ppp. May be authorised at national level under different legislation |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not applicable - not a ppp. May be authorised at national level under different legislation |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₂H₄O₃ |
|
|
CC(=O)OO |
|
|
No data |
|
|
KFSLWBXXFJQRDL-UHFFFAOYSA-N |
|
|
InChI=1S/C2H4O3/c1-2(3)5-4/h4H,1H3 |
|
|
Yes |
|
|
Fungicide, Nematicide, Microbiocide |
|
|
Inorganic compound |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Broad-spectrum, contact action, effect arises from the corrosive nature of the substance |
|
|
79-21-0 |
|
|
201-186-8 |
|
|
None allocated |
|
|
063201 |
|
|
6585 |
|
|
607-094-00-8 |
|
|
76.05 |
|
|
- |
|
|
peroxyacetic acid |
|
|
peracetic acid |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
NC |
|
|
- |
|
|
Colourless liquid |
|
|
|
|
|
|
|
|
- Desoxon 1
- Osbon AC
- Rendition
|
|
|
- |
|
|
|
|
|
|
|
1000000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source at 25 °C |
High |
|
|
Miscible |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Ether |
- |
|
|
0.1 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
110 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
40.5 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
|
8.13 X 10-02 |
Calculated |
- |
|
|
-1.09 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.226 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
8.2 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
| Weak acid |
|
|
190000 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Highly volatile |
|
|
0.217 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
2.0 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Non-persistent |
|
|
2.0 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Short lived in the environment due to its high reactivity. DT₅₀ expected to be around 2 days at pH7. |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Very mobile |
|
|
1.5 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
1.15 |
Calculated |
Low leachability |
|
|
|
2.97 X 10-03 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Very mobile |
Calculated |
- |
|
|
|
1 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 330 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
13.0 |
V4 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
0.2 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data Cyprinus carpio 30 days |
Moderate |
|
|
3.3 |
V4 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.18 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Pseudokirchneriella subcapitata 120 hr |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 330 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
1410 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rabbit |
- |
|
|
> 0.5 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
Occupational exposure to peracetic acid can occur through dermal contact and inhalation of vapour |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause severe gastrointestinal tract irritation and renal failure Vapours may cause dizziness |
|
|
|
|
|
Unstable - may explode on heating Caustic and corrosive IMDG Transport Hazard Class 5.2 |
|
|
Health: H302, H312, H314, H332 Handling: H226, H242 Environment: H400 |
|
|
Not listed |
|
|
UN3105 |
|
|
Packaging Group II (moderate danger) |
|
|
- |
|
|
|
|
|
peroxyacetic acid |
|
|
acide peracetique |
|
|
- |
|
|
- |
|
|
- |
|
|
acido peroxiacetico |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |