| Permethrin (Ref: OMS 1821) |
(Also known as: permethrine) |
| Permethrin is a contact insecticide. It is not highly soluble in water, has a low volatility and is not normally expected to leach to groundwater. It would also not be expected to persist in soil or water systems. It is moderately toxic to humans, is an irritant and may be a CNS toxicant. It is highly toxic to most aquatic species and honey bees but is not highly toxic to birds or earthworms. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Moderately persistent; Potential for particle bound transport: Medium
 |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High; Bees acute oral ecotoxicity: High
 |
Human health High alert: Carcinogen; Endocrine distrupter; Reproduction/development effects; Neurotoxicant
 |
|
|
An insecticide active against a wide range of pests including Lepidoptera and Coleoptera in crops and various animal ectoparasites |
|
|
Cockroaches; Termites; Ticks; Mosquitoes; Aphids; Fleas; Ants |
|
|
Fruit; Vegetables; Cotton; Ornamentals; Potatoes; Cereals |
|
|
- |
|
|
Current |
|
|
circa 1973 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Ireland |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Permethrin is a chiral molecule presenting two forms, the cis and the trans isomers. |
|
|
C₂₁H₂₀Cl₂O₃ |
|
|
CC1(C(C1C(=O)OCC2=CC(=CC=C2)OC3=CC=CC=C3)C=C(Cl)Cl)C |
|
|
- |
|
|
RLLPVAHGXHCWKJ-UHFFFAOYSA-N |
|
|
InChI=1S/C21H20Cl2O3/c1-21(2)17(12-18(22)23)19(21)20(24)25-13-14-7-6-10-16(11-14)26-15-8-4-3-5-9-15/h3-12,17,19H,13H2,1-2H3/t17-,19-/m0/s1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
|
Insecticide, Veterinary substance |
|
|
Pyrethroid insecticide; Pyrethroid ester insecticide |
|
|
>=90% |
|
|
- |
|
|
Synthetic |
|
|
Broad spectrum with contact and stomach action. Slight repellant effect. Sodium channel modulator. |
|
|
52645-53-1 |
|
|
258-067-9 |
|
|
331 |
|
|
109701 |
|
|
40326 |
|
|
613-058-00-2 |
|
|
391.29 |
|
|
- |
|
|
3-phenoxybenzyl (1RS,3RS;1RS,3SR)-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate |
|
|
(3-phenoxyphenyl)methyl 3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate |
|
|
Chemical subject to PIC regulations |
|
|
UK statutory standard for the protection of aquatic life: freshwater and saltwater: 0.01 µg l⁻¹ |
|
|
Not applicable |
|
|
Not applicable |
|
|
3A |
|
|
Not applicable |
|
|
Aedes aegypti, Bemisia tabaci, Chrysoperla carnea, Culex pipiens pipiens, Diadegma insulare, Helicoverpa zea, many others |
|
|
Colourless crystalline solid to brown viscous liquid depending upon purity |
|
|
|
|
|
- Agropharm
- ICI Plant Protection
- Mitchell Cotts
- FMC
- BOC Sciences
|
|
|
- Fortefog P Fumer
- Ambush
- Exmin
- Kestril
- Ectiban
- Pynosect
- Corsair
- Arctic
|
|
|
Available in a variety of formulations including fumigants, shampoos and spot-on treatments |
|
|
|
|
|
|
|
0.011 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
|
1000000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
| 258000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 1000000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
|
|
34.5 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
465.9 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
159.4 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
|
1.26 X 1006 |
Calculated |
- |
|
|
6.1 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
1.19 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.007 |
R4 R = Peer reviewed scientific publications 4 = Verified data at 25°C |
Low volatility |
|
|
1.89 X 10-01 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
13 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
|
13 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
|
42 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
6.7 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 2.5-20.0 days, 8 field & undercover grown crops, various matrices, n=9 |
|
|
|
11.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 9.5-13.9 days, 3 field & undercover grown crops, various matrices, n=3 |
|
|
|
1 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
|
|
- |
|
|
|
31 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately persistent |
|
|
- |
|
|
40 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Moderately fast |
|
|
23 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Slow |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Non-mobile |
|
|
100000 |
|
|
- |
|
|
|
1.87 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
- |
|
|
0.99 |
|
|
Soil with 68% loam, 24% silt, 8% clay, pH 6.5, OC=2.1% |
|
|
- |
|
|
|
|
|
|
|
-1.62 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
|
Medium |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
300 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data (Other literature Log BCF range 1.4-3.3 (R3)) |
Threshold for concern |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 430 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Moderate |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
100 |
- |
|
|
- |
- |
- |
|
|
> 9800 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1440 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
0.024 |
Apis mellifera |
High |
|
|
0.13 |
Apis mellifera |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 0.22 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terrestris |
High |
| Literature DT₅₀ values range 0.22-0.82 µg bee⁻¹ |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
0.0157 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
|
Contact |
|
|
|
0.07 |
R4 R = Peer reviewed scientific publications 4 = Verified data Trigona spinipes |
High |
|
|
Contact |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Parasitic wasp |
- |
|
|
Harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.0125 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Oncorhynchus mykiss |
High |
|
|
0.000093 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Anabas testudineus |
High |
|
|
0.0006 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
0.00002 |
Americamysis bahia |
High |
|
|
0.0029 |
Chironomus riparius |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.0125 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Unknown species |
Moderate |
|
|
0.0009 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Unknown species |
High |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 430 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Moderate |
|
|
2000 |
Rabbit |
- |
|
|
> 0.685 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
Intraperitoneal LD₅₀ = 429 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Mouse |
- |
| Intravenous LD₅₀ = 31.0 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Mouse |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
Non-statutory WHO drinking water guideline 0.3 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
|
- |
- |
- |
|
|
Rapidly metabolised by ester hydrolysis to inactive metabolites which are excreted primarily in the urine |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
?Possibly, status not identified |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Harmful Estrogenic IARC Group 3 carcinogen; USEPA - probable human carcinogen Endocrine issues - Inhibition of estrogen-sensitive cells proliferation |
|
|
|
|
|
IMDG Transport Hazard Class 6.1 |
|
|
Health: H302, H332, H335 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
Chemically stable under standard ambient conditions. Shelf-life of 2 yrs. Store -20 DegC in an inert atmosphere |
|
|
|
|
|
permethrin |
|
|
permethrine |
|
|
Permethrin |
|
|
permethrin |
|
|
permetrina |
|
|
permetrin |
|
|
permethrin |
|
|
permetryna |
|
|
permetrin |
|
|
permetrin |
|
|
permethrin |
|
|
- |