| Parathion-methyl (Ref: OMS 213) |
(Also known as: metaphos; meptox; thiophenit; quinophos; methyl-parathion) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 |
Ecotoxicity High alert: Fish chronic ecotoxicity: High; Daphnia acute ecotoxicity: High; Daphnia chronic ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An insecticide used to control sucking and chewing insects in a wide range of crops |
|
|
Aphids; Boll weevils; Mealybugs; Scale; Armyworms |
|
|
Cereals; Cotton; Vegetables; Soybean; Fruit; Vines |
|
|
- |
|
|
Current |
|
|
circa 1950 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Italy |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Australia, USA, Costa Rica |
|
|
None |
|
|
C₈H₁₀NO₅PS |
|
|
COP(=S)(OC)OC1=CC=C(C=C1)[N+](=O)[O-] |
|
|
No data |
|
|
RLBIQVVOMOPOHC-UHFFFAOYSA-N |
|
|
InChI=1S/C8H10NO5PS/c1-12-15(16,13-2)14-8-5-3-7(4-6-8)9(10)11/h3-6H,1-2H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| parathion-methyl |
- |
 |
|
|
Insecticide |
|
|
Organophosphate insecticide; Organophosphate acaricide; Organothiophosphate insecticide; Organothiophosphate acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Contact and stomach insecticide. Cholinesterase inhibitor. |
|
|
298-00-0 |
|
|
206-050-1 |
|
|
487 |
|
|
053501 |
|
|
4130 |
|
|
015-035-00-7 |
|
|
263.21 |
|
|
- |
|
|
O,O-dimethyl O-4-nitrophenyl phosphorothioate |
|
|
O,O-dimethyl O-(4-nitrophenyl) phosphorothioate |
|
|
Chemical subject to PIC regulations; Potential groundwater contaminant; Marine Pollutant; Subject to the provisions of the UK Poisons Act 1972 |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Aedes melanimon, Aedes nigromaculis, Anopheles albimanus, Coleomegilla maculata, Culex pipiens pallens, many others |
|
|
Colourless crystals |
|
|
|
|
|
|
|
|
- Bayer CropScience
- FCC Ltd
- Cheminova A/S
- Monsanto
|
|
|
- Sweeper
- Amithion
- Prompt
- Sabidol
- Wolfatox
|
|
|
Available in a wide variety of formulations including dustable powders, emulsifible concentrates, encapsulated suspensions, ULV liquid and wettable powders. |
|
|
|
|
|
|
|
55 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Dichloromethane |
- |
| 200000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 15000 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Hexane |
- |
|
|
35.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
150 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
1.00 X 1003 |
Calculated |
- |
|
|
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.36 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
0.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
8.57 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
12 |
Y4 Y = Germany's Federal Environment Agency (UBA) (click here ) 4 = Verified data |
Non-persistent |
|
|
12 |
Y4 Y = Germany's Federal Environment Agency (UBA) (click here ) 4 = Verified data |
Non-persistent |
|
|
10 |
Y4 Y = Germany's Federal Environment Agency (UBA) (click here ) 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
PIC DGD states lab DT₅₀ range 1-18 days |
|
|
|
3.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 0.4-6.7 days, 6 field crops, various matrices, n=8 |
|
|
|
1.9 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 0.7-6.6 days, 7 field crops, various matrices, n=12; Fruit in cold storage RL₅₀ range 63-65 days, n=2 |
|
|
|
9 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately fast |
|
|
- |
|
|
|
21 |
K4 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 4 = Verified data |
Non-persistent |
|
|
- |
|
|
5 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Fast |
|
|
15 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Slow |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
W3 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 3 = Unverified data of known source |
Moderately mobile |
|
|
240 |
|
|
- |
|
|
|
34.4 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile |
|
|
442 |
|
|
1.038 |
|
|
Literature data: Kf range 8.0-37.8 (178 for peat) mL g⁻¹, Kfoc range 276-677 (276 for peat) mL g⁻¹, 1/n range 0.909-1.123, Soils=8 |
|
|
- |
|
|
|
|
|
|
|
1.35 |
Calculated |
Low leachability |
|
|
|
1.93 X 10-02 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
71 |
J3 J = Pesticide Action Network database (click here ) 3 = Unverified data of known source Oncorhynchus mykiss |
Low potential |
|
|
Not available |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
2 |
- |
|
|
- |
- |
- |
|
|
> 1044 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Anas platyrhynchos |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
40 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
19.5 |
Apis mellifera |
Moderate |
|
|
750 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
0.0157 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
|
Contact |
|
|
|
0.096 |
R4 R = Peer reviewed scientific publications 4 = Verified data Trigona spinipes |
High |
|
|
Contact |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 2.7 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
0.0089 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Cyprinodon variegatus |
High |
|
|
> 0.0073 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
High |
|
|
0.00018 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
High |
|
|
0.00035 |
Americamysis bahia |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
115 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Chironomus dilutus growth |
Low |
|
|
- |
- |
- |
|
|
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scenedesmus subspicatus |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
3 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
High |
|
|
45.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
0.17 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
Skin absorption, and to a lesser extent inhalation and ingestion |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Almost completely excreted by the kidneys (urine) within 24 hours as phenolic metabolites |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Extremely hazardous IARC Group 3 carcinogen; USEPA - not likely to be a human carcinogen |
|
|
|
|
|
Explosive on heating Flammable IMDG Transport Hazard Class 6.1 |
|
|
Handling: H226 Health: H300, H311, H330, H373 Environment: H400, H410 |
|
|
Ia (Extremely hazardous) |
|
|
UN2783 |
|
|
- |
|
|
- |
|
|
|
|
|
parathion-methyl |
|
|
parathion-methyl |
|
|
Parathion-methyl |
|
|
parathion-methyl |
|
|
paration-metile |
|
|
paratión-metil |
|
|
parathion-methyl |
|
|
paration metylu |
|
|
- |
|
|
- |
|
|
parathion-methyl |
|
|
- |