| Paraquat dimetilsulfate |
(Also known as: paraquat methosulfate) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
|
Human health Moderate alert: Possible Reproduction/development effects
 |
|
|
A herbicide used to control common weeds and grasses in a wide range of agricultural and amenity situations |
|
|
Broad-leaved weeds including cocksfoot; Grasses including wild oats, Yorkshire fog grass, ryegrass, fescue |
|
|
Rice; Lucerne; Beans & peas; Hops; Vineyards; Potaoes; Non-cropped areas such as roadways, paths |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
UK |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes (as paraquat) |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₄H₂₀N₂O₈S₂ |
|
|
C[N+]1=CC=C(C=C1)C2=CC=[N+](C=C2)C.COS(=O)(=O)[O-].COS(=O)(=O)[O-] |
|
|
- |
|
|
WXJYKXOIFICRPR-UHFFFAOYSA-L |
|
|
InChI=1S/C12H14N2.2CH4O4S/c1-13-7-3-11(4-8-13)12-5-9-14(2)10-6-12;2*1-5-6(2,3)4/h3-10H,1-2H3;2*1H3,(H,2,3,4)/q+2;;/p-2 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
|
Herbicide |
|
|
Quarternary ammonium herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Broad-spectrum, non-residual activity with contact and some desiccant action. Photosystem I (electron transport) inhibitor. |
|
|
2074-50-2 |
|
|
218-196-3 |
|
|
56 |
|
|
- |
|
|
62422 |
|
|
613-090-00-7 |
|
|
408.45 |
|
|
1,1′-dimethyl-[4,4′-bipyridine]-1,1′-diium bis(methyl sulfate) |
|
|
1,1′-dimethyl-4,4′-bipyridinium bis(methyl sulfate) |
|
|
1,1′-dimethyl-4,4′-bipyridinium bis(methyl sulfate) |
|
|
PAN Dirty Dozen; Chemical subject to PIC regulations; Subject to the provisions of the UK Poisons Act 1972 |
|
|
- |
|
|
D |
|
|
22 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Lolium rigidum |
|
|
- |
|
|
|
|
|
|
|
|
- Syngenta
- ICI Plant Protection
- Pillar International
- Inquinosa
|
|
|
- |
|
|
Usually formulated as a soluble concentrate or aqueous liquid |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.004 |
as paraquat |
- |
|
|
0.005 |
as paraquat |
- |
|
|
- |
- |
- |
|
|
0.0004 |
as paraquat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
No unacceptable risks to bystanders identified |
|
|
No unacceptable risks to operators or other workers identified |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Potential liver, kidney, stomach, intestine and respiratory system toxicant May damage lungs if inhaled |
|
|
|
|
|
Not explosive or oxidising IMDG Transport Hazard Class 6.1 Not expected to autoignite; Not highly flammable |
|
|
- |
|
|
II (Moderately hazardous) |
|
|
UN2811 |
|
|
Packaging Group II (moderate danger) |
|
|
- |
|
|
|
|
|
paraquat dimetilsulfate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |