| Oxpoconazole fumarate (Ref: UR 50302) |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Potential for particle bound transport: Medium
 |
Ecotoxicity Moderate alert: Birds acute ecotoxicity: Moderate; Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health Moderate alert: Mammals acute toxicity: Moderate; Neurotoxicant
 |
|
|
Used to control a variety of paddy fungal diseases including rice blast |
|
|
Rice blast Magnaporthe orzyzae; Sheath blast Rhizoctonia solani |
|
|
Rice seedlings |
|
|
- |
|
|
- |
|
|
2000, Japan |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Oxpoconazole fumarate is a chiral molecule. The commerical material is a racemate comprising equimolar amounts of (R)- and (S)-oxpoconazole fumarate. |
|
|
C₄₂H₅₂Cl₂N₆O₈ |
|
|
CC1(COC(N1C(=O)N2C=CN=C2)(C)CCCC3=CC=C(C=C3)Cl)C.CC1(COC(N1C(=O)N2C=CN=C2)(C)CCCC3=CC=C(C=C3)Cl)C.C(=CC(=O)O)C(=O)O |
|
|
CC1(COC(N1C(=O)N2C=CN=C2)(C)CCCC3=CC=C(C=C3)Cl)C.CC1(COC(N1C(=O)N2C=CN=C2)(C)CCCC3=CC=C(C=C3)Cl)C.C(=C/C(=O)O)\C(=O)O |
|
|
IKNXXTIMVROREQ-WXXKFALUSA-N |
|
|
InChI=1S/C14H15O2PS2/c1-2-16-17(15,18-13-9-5-3-6-10-13)19-14-11-7-4-8-12-14/h3-12H,2H2,1H3 |
|
|
Yes |
|
|
Fungicide |
|
|
Triazole fungicide; Conazole fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic, curative with residual activity, inhibits ergosterol biosynthesis |
|
|
174212-12-5 |
|
|
No data found |
|
|
None allocated |
|
|
- |
|
|
18772466 |
|
|
No data found |
|
|
839.8 |
|
|
(2E)-but-2-enedioic acid—rac-{(2R)-2-[3-(4-chlorophenyl)propyl]-2,4,4-trimethyl-1,3-oxazolidin-3-yl}(1H-imidazol-1-yl)methanone (1/2) |
|
|
{(RS)-2-[3-(4-chlorophenyl)propyl]-2,4,4-trimethyl-1,3-oxazolidin-3-yl}(imidazol-1-yl)methanone fumarate (2:1) |
|
|
2-[3-(4-chlorophenyl)propyl]-3-(1H-imidazol-1-ylcarbonyl)-2,4,4-trimethyloxazolidine (2E)-2-butenedioate (2:1) |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
3 |
|
|
- |
|
|
Colourless crystalline solid |
|
|
|
|
|
|
|
|
|
|
89.5 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
124 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
4.90 X 1003 |
Calculated |
- |
|
|
3.69 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
1.33 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
4.08 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
| Weak acid |
|
|
0.00542 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
28 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature field studies DT₅₀ range 23-34 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
0.4 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Fast |
|
|
Data for sunlight conditions |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-mobile |
|
|
17275 |
|
|
General literature Koc range 1250-33300 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
-0.34 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
|
Medium |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1035 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
1125 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
7.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Cyprinus carpio |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.81 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1035 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
2000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
4.40 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
May be harmful if mist or vapour is inhaled May cause nausea, vomiting, dizziness and drowsiness, pulmonary edema and central nervous system depression |
|
|
|
|
|
Not expected to autoignite; Not highly flammable |
|
|
- |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
oxpoconazole fumarate |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |