| Orysastrobin |
(Not known by any other names) |
| Orysastrobin is a rice fungicide. It has a moderate aqueous solubility, is volatile and, based on its chemical properties, is mobile and can be expected to leach to groundwater. It is generally moderately persistent in soil systems but will not usually persist in aquatic systems under certain conditions. It is not generally susceptible to hydrolysis. It has a moderate mammalian toxicity and has a high potential to bioaccumulate. It is moderately toxic to most aquatic species, birds and earthworms but relatively non-toxic to honey bees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Possible Carcinogen; Possible Reproduction/development effects
 Warning: Significant data are missing |
|
|
A rice fungicide that is highly effective against rice blast and other fungal pathogens. |
|
|
Magnaporthe oryzae; Pyricularia oryzae; Thanatephorus cucumeris; Rhizoctonia solani |
|
|
Rice |
|
|
- |
|
|
Current |
|
|
2006 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
An achiral molecule, with no optical activity or defined stereocenters but which does have 4 E/Z centres. |
|
|
C₁₈H₂₅N₅O₅ |
|
|
CC(=NOC)C(=NOC)C(=NOCC1=CC=CC=C1C(=NOC)C(=O)NC)C |
|
|
C/C(=N\OC)/C(=N\OC)/C(=N/OCC1=CC=CC=C1/C(=N\OC)/C(=O)NC)/C |
|
|
JHIPUJPTQJYEQK-ZLHHXESBSA-N |
|
|
InChI=1S/C18H25N5O5/c1-12(20-25-4)16(22-26-5)13(2)21-28-11-14-9-7-8-10-15(14)17(23-27-6)18(24)19-3/h7-10H,11H2,1-6H3,(H,19,24)/b20-12+,21-13+,22-16+,23-17+/f/h19H |
|
|
Yes |
|
|
Fungicide |
|
|
Strobilurin fungicide; Amide fungicide; Methoxyiminoacetamide strobilurin fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Systemic, broad spectrum with protective and curative properties. Interferes with the respiration process. Respiration inhibitor (QoL fungicide). |
|
|
248593-16-0 |
|
|
607-448-1 |
|
|
None allocated |
|
|
- |
|
|
11486133 |
|
|
No data found |
|
|
391.43 |
|
|
(2E)-2-(methoxyimino)-2-{2-[(3E,5E,6E)-5-(methoxyimino)-4,6-dimethyl-2,8-dioxa-3,7-diazanona-3,6-dien-1-yl]phenyl}-N-methylacetamide |
|
|
(2E)-2-(methoxyimino)-2-{2-[(3E,5E,6E)-5-(methoxyimino)-4,6-dimethyl-2,8-dioxa-3,7-diazanona-3,6-dien-1-yl]phenyl}-N-methylacetamide |
|
|
(αE)-α-(methoxyimino)-2-[(3E,5E,6E)-5-(methoxyimino)-4,6-dimethyl-2,8-dioxa-3,7-diaza-3,6-nonadienyl]-N-methylbenzeneacetamide |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
11 |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
80.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderate |
|
|
206000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Ethyl acetate |
- |
| 590 |
R4 R = Peer reviewed scientific publications 4 = Verified data n-Heptane |
- |
| 125000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Toluene |
- |
| 33900 |
R4 R = Peer reviewed scientific publications 4 = Verified data Propanol |
- |
|
|
99 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.29 X 1002 |
Calculated |
- |
|
|
2.36 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
7.0 X 10-04 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
55 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent |
|
|
- |
- |
- |
|
|
55 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Manufacturers published information gives DT₅₀ 51-58 days for field studies |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
0.8 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Fast |
|
|
- |
|
|
|
365 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Very persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile |
|
|
92 |
|
|
Manufacturers published information gives Koc range 17.9-146 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
3.54 |
Calculated |
High leachability |
|
|
|
6.25 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 356 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
142 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.89 |
R4 R = Peer reviewed scientific publications 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
1.3 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
7.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data Pseudokirchneriella subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 356 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
Moderate |
|
|
2000 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
|
2.02 |
R4 R = Peer reviewed scientific publications 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Toxic by inhalation |
|
|
|
|
|
No information available |
|
|
Health: H302, H332, H351 Environment: H410 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
orysastrobin |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
orysastrobina |
|
|
- |
|
|
- |
|
|
- |
|
|
- |