| O,O'-DDT |
(Not known by any other names) |
| DDT is a banned organochlorine insecticide. It has a low aqueous solubility, is relatively volatile and has a low potential to leach to groundwater. It is highly persistent in soil and non-mobile. It is moderately toxic by the oral route in humans and other mammals but is a carcinogen and endocrine disrupter. It shows a high to moderate level of toxicity to most animals and insects although it is relatively non-toxic to birds |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
|
Human health High alert: Reproduction/development effects; Neurotoxicant
 |
|
|
A minor isomer of the obsolete and banned insecticide that was used to control insect vectors of disease, especially malaria |
|
|
Mosquitoes; Houseflies; Body lice; Colarado beetles; Gypsy moths |
|
|
Agricultural crops; Domestic houses; Offices, commercial and industrial situations; Non-cropped sites including roads, rights-of-way; parkland |
|
|
Not applicable |
|
|
Not applicable |
|
|
1944 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes as DDT |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A minor isomer of DDT |
|
|
C₁₄H₉Cl₅ |
|
|
C1=CC=C(C(=C1)C(C2=CC=CC=C2Cl)C(Cl)(Cl)Cl)Cl |
|
|
- |
|
|
RWNHNFLMAFMJIC-UHFFFAOYSA-N |
|
|
InChI=1S/C14H9Cl5/c15-11-7-3-1-5-9(11)13(14(17,18)19)10-6-2-4-8-12(10)16/h1-8,13H |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| DDT |
Unstated isomer |
 |
|
|
Insecticide |
|
|
Soil |
|
|
Organochloride insecticide; Organochloride acaricide; Bridged diphenyl insecticide; Bridged diphenyl acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Central nervous system stimulant. GABA-gated chloride channel antagonist. Sodium channel modulator. |
|
|
6734-84-5 |
|
|
- |
|
|
3 |
|
|
- |
|
|
154395 |
|
|
354.48 |
|
|
1-chloro-2-(2,2,2-trichloro-1-(2-chlorophenyl)ethyl)benzene |
|
|
1-chloro-2-(2,2,2-trichloro-1-(2-chlorophenyl)ethyl)benzene |
|
|
- |
|
|
Banned; WFD priority substance; Subject to PIC regulations; POP - regulated by Stockholm Convention; LRTAP Annex I; PAN Dirty Dozen; OSPAR soc; Marine Pollutant; Rotterdam Convention (Class II) |
|
|
EU Directive 2008/105/EC EQS for total DDT surface waters: annual average 0.025 µg l⁻¹ UK statutory standard for protection of aquatic life for inland, coastal & territorial surface waters: 0.025 µg l⁻¹ as annual mean conc |
|
|
Not applicable |
|
|
Not applicable |
|
|
3B |
|
|
Not applicable |
|
|
Wide variety of insects are resistant |
|
|
- |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
|
|
|
|
|
|
|
Relevancy unknown |
- |
- |
|
|
Relevancy unknown |
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I, II |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
Non-statutory WHO drinking water guideline 0.001 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
|
- |
- |
- |
|
|
Mainly excreted in the urine but some also occurs by way of faeces (via biliary excretion) |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E2 E = Unspecified genotoxicity type (miscellaneous data source) 2 = Mixed/ambiguous results |
?Possibly, status not identified |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
No data found |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
| No data found |
No data found |
|
|
|
|
Toxic by ingestion, inhalation and via skin absorption Xenoestrogen agent Mutagenic Endocrine issues - Competitive binding to androgen receptors |
|
|
|
|
|
No information available |
|
|
Health: H301, H311, H330, H351, H372, H373 Environment: H400, H410 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
O,O'-DDT |
|
|
o,o'-DDT |
|
|
o,o'-DDT |
|
|
o,o'-DDT |
|
|
o,o'-DDT |
|
|
o,o'-DDT |
|
|
o,o'-DDT |
|
|
o,o'-DDT |
|
|
o,o'-DDT |
|
|
o,o'-DDT |
|
|
o,o'-DDT |
|
|
- |