| Octhilinone (Ref: RH 893) |
(Also known as: Skane M8) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability
 Warning: Significant data are missing |
Ecotoxicity High alert: Fish acute ecotoxicity: High; Fish chronic ecotoxicity: High
 |
Human health Moderate alert: Mammals acute toxicity: Moderate
 |
|
|
A broad-spectrum fungicide for treating bacterial and fungal diseases on trees. It also has applications as a material preservative. |
|
|
Canker; Tree wounds; Yeasts; Moulds |
|
|
Fruit trees; Ornamental trees |
|
|
- |
|
|
Current |
|
|
- |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₁H₁₉NOS |
|
|
CCCCCCCCN1C(=O)C=CS1 |
|
|
No data |
|
|
JPMIIZHYYWMHDT-UHFFFAOYSA-N |
|
|
InChI=1S/C11H19NOS/c1-2-3-4-5-6-7-9-12-11(13)8-10-14-12/h8,10H,2-7,9H2,1H3 |
|
|
Yes |
|
|
Fungicide, Bactericide, Biocide |
|
|
Thiazole fungicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibits fungal growth by inhibiting nucleic acid synthesis (DNA / RNA synthesis). |
|
|
26530-20-1 |
|
|
247-761-7 |
|
|
None allocated |
|
|
099901 |
|
|
33528 |
|
|
613-112-00-5 |
|
|
213.34 |
|
|
- |
|
|
2-octyl-1,2-thiazol-3(2H)-one |
|
|
2-octyl-3(2H)-isothiazolone |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
32 |
|
|
- |
|
|
Yellow solid |
|
|
|
|
|
|
|
500 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Moderate |
|
|
800000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Methanol |
- |
| 800000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Toluene |
- |
| 900000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Ethyl acetate |
- |
| 64000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
|
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
120 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.82 X 1002 |
Calculated |
- |
|
|
2.45 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
4.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
2.09 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
40 |
S1 S = Expert judgement 1 = Estimated data with little or no verification |
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Moderately mobile |
|
|
135 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
3.00 |
Calculated |
High leachability |
|
|
|
2.85 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
550 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
|
150 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 18 month |
Moderate |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 346 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Colinus virginianus |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.065 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
|
0.0085 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Pimephales promelas |
High |
|
|
0.18 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
<= 0.08 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
0.0055 |
Americamysis bahia |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
550 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
Moderate |
|
|
4.22 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat (as ml/kg) |
- |
|
|
0.58 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Highly toxic by ingestion, inhalation and skin contact |
|
|
|
|
|
Flammable |
|
|
Health: H302; H311; H314; H317; H331 Environment: H400, H410 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
octhilinone |
|
|
octhilinone |
|
|
Octhilinon |
|
|
octhilinon |
|
|
octilinone |
|
|
octilinon |
|
|
- |
|
|
oktylinon |
|
|
- |
|
|
- |
|
|
- |
|
|
- |