| Noviflumuron |
(Also known as: XDE-007) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate
 |
Human health Low alert
 Warning: Significant data are missing |
|
|
An insect growth regulator insecticide that is a structural analog of hexaflumuron and is used to control a wide range of pest management ISSUES |
|
|
Termites; Ants; Cockroaches; Fleas; Flies |
|
|
- |
|
|
- |
|
|
Current |
|
|
2003, USA |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A chiral molecule. The technical material is an isomeric mixture. |
|
|
C₁₇H₇Cl₂F₉N₂O₃ |
|
|
C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=C(C(=C2F)Cl)OC(C(C(F)(F)F)F)(F)F)Cl)F |
|
|
- |
|
|
YTYGAJLZOJPJGH-UHFFFAOYSA-N |
|
|
InChI=1S/C17H7Cl2F9N2O3/c18-5-4-8(29-15(32)30-13(31)9-6(20)2-1-3-7(9)21)11(22)10(19)12(5)33-17(27,28)14(23)16(24,25)26/h1-4,14H,(H2,29,30,31,32) |
|
|
Yes |
|
|
Insecticide |
|
|
Benzoylurea insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibitor of chitin biosynthesis affecting CHS1. |
|
|
121451-02-3 |
|
|
601-779-5 |
|
|
None allocated |
|
|
118204 |
|
|
9828359 |
|
|
No data found |
|
|
529.15 |
|
|
rac-N-({3,5-dichloro-2-fluoro-4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl}carbamoyl)-2,6-difluorobenzamide |
|
|
(RS)-1-[3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]-3-(2,6-difluorobenzoyl)urea |
|
|
N-[ [ [3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy) phenyl] amino] carbonyl]-2,6-difluorobenzamide |
|
|
Marine pollutant; This pesticide is a PFAS based on the US definition |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
15 |
|
|
Not known |
|
|
- |
|
|
White powder |
|
|
|
|
|
|
|
|
- Recruit
- Noviflumuron XDE-007
- Sentricon
|
|
|
- |
|
|
|
|
|
|
|
0.194 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low |
|
|
425000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Acetone |
- |
| 290000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Ethyl acetate |
- |
| 48900 |
E4 E = Manufacturers safety data sheets 4 = Verified data Methanol |
- |
| 68 |
E4 E = Manufacturers safety data sheets 4 = Verified data Heptane |
- |
|
|
156.2 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
Decomposes before boiling |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
250 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
8.71 X 1004 |
Calculated |
- |
|
|
4.94 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.88 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
| - |
|
|
2.2 X 10-07 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
250 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
DT₅₀ in aerobic soils is 200-300 days at 25 °C |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
E4 E = Manufacturers safety data sheets 4 = Verified data |
Stable |
|
|
pH sensitive: Stable in acid and neutral media, DT₅₀ 19 days at pH 9 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Non-mobile |
|
|
250000 |
|
|
Koc values range 32,000-470000 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
-3.35 |
Calculated |
Low leachability |
|
|
|
5.35 X 10-03 |
Calculated |
- |
|
|
Estimated concentrations of chemicals with Koc values greater than 9995 ml g⁻¹ are beyond the scope of the regression data used in SCI-GROW development. If there are concerns for such chemicals, a higher tier groundwater exposure assessment should be considered, regardless of the concentration returned by SCI-GROW |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 10000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Eisenia foetida |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Low |
|
|
> 100 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
1.8 |
E4 E = Manufacturers safety data sheets 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
3.11 |
E4 E = Manufacturers safety data sheets 4 = Verified data Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
Low |
|
|
5000 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
|
5.24 |
E4 E = Manufacturers safety data sheets 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk of exposure due to delivery system |
|
|
Low risk of exposure due to delivery system |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
No data found |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
IMDG Transport Hazard Class 9 Not expected to autoignite; Not highly flammable |
|
|
- |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
noviflumuron |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |