| Niclosamide (Ref: ENT 25823 ) |
(Also known as: clonitralide) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Slightly mobile
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate
 |
Human health Moderate alert: Possible Reproduction/development effects
 Warning: Significant data are missing |
|
|
A relatively selective substance used to control aquatic pests and as an antiparasitic control agent for humans and animals |
|
|
Aquatic snails; Sea lamprey |
|
|
Aquatic situations |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₃H₈Cl₂N₂O₄ |
|
|
C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)C2=C(C=CC(=C2)Cl)O |
|
|
- |
|
|
RJMUSRYZPJIFPJ-UHFFFAOYSA-N |
|
|
InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19) |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| niclosamide |
- |
 |
|
|
Fungicide, Molluscicide, Nematicide, Veterinary substance, Teniacide |
|
|
Chloronitrophenol molluscidie |
|
|
>96% |
|
|
- |
|
|
Synthetic |
|
|
Respiratory & stomach action. Acts by uncoupling oxidative phosphorylation in the tapeworm |
|
|
50-65-7 |
|
|
200-056-8 |
|
|
599 |
|
|
- |
|
|
4477 |
|
|
No data found |
|
|
327.12 |
|
|
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
|
|
2'5-dichloro-4'-nitrosalicylanilide |
|
|
5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Yellow-grey coloured crystalline solid |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Available in a variety of formulations for oral administration as a veterinary treatment and as an emulsifiable concentrate for aquatic use. |
|
|
|
|
|
|
|
5.0 |
|
Low |
|
|
- |
- |
- |
|
|
224 |
|
- |
|
|
- |
- |
- |
|
|
208 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
3.63 X 1004 |
Calculated |
- |
|
|
4.56 |
Other data: 1.0 at pH 9.6 |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
5.6 |
|
- |
| - |
|
|
8.0 X 10-08 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
2.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Pakchoi leaves, n=1 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
106 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Slightly mobile |
|
|
3112 |
|
|
Literature values for sediments: Kd range 52.2-186.5 mL g⁻¹, Koc range 1742-4980 mL g⁻¹, soils=5 |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
Yes |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
250 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
Threshold for concern |
|
|
Not available |
- |
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
|
| 2,5-dichloro-4-aminosalicylanilide |
- |
Rat (Urine) |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 5000 |
Rat |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.34 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
0.2 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
0.02 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
1.6 |
Chironomus riparius 48 hour |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
5.0 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Scendesmus subspicatus |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 5000 |
Rat |
Low |
|
|
2000 |
Rat |
- |
|
|
- |
- |
- |
|
|
Intraperitoneal LD₅₀ = 250 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
| Intravenous LD₅₀ = 7.5 mg kg⁻¹ |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Mouse |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
May be absorbed through the skin or mucous membranes |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Some metabolism, metabolitesand unchanged parent lost mainly via the faeces |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause gastrointestinal problems, anorexia, irritability & alopecia Salts may cause occular irritation Harmful if swallowed |
|
|
|
|
|
Avoid formation of dust IMDG Transport Hazard Class 9 |
|
|
- |
|
|
U (Unlikely to present an acute hazard) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
niclosamide |
|
|
niclosamide |
|
|
clonitralid |
|
|
- |
|
|
- |
|
|
niclosamida |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |