| Naled (Ref: OMS 75) |
(Also known as: bromchlophos; BRP; dibrom; hibrom; bromex) |
| Naled is mainly used for non-food applications. As an organophosphorus there are toxicity concerns and may cause cholinesterase inhibition in humans. Naled is practically nonpersistent in the environment with very rapid soil degradation rates. It is also not mobile and so should not be a risk to groundwater. It is toxic to birds and aquatic organisms and may pose a risk to honeybees. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: Drainflow: Moderately mobile
 Warning: Significant data are missing |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Reproduction/development effects; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An insecticide used to control aphids, mites, mosquitoes, flies and many other pests |
|
|
Aphids; Mites; Mosquitoes; Flies |
|
|
Fruit; Vegetables; Nuts; Poultry houses; Mushroom houses; Kennels |
|
|
- |
|
|
Current |
|
|
1956 |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
France |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A molecule with one chiral feature. |
|
|
C₄H₇Br₂Cl₂O₄P |
|
|
COP(=O)(OC)OC(C(Cl)(Cl)Br)Br |
|
|
No data |
|
|
BUYMVQAILCEWRR-UHFFFAOYSA-N |
|
|
InChI=1S/C4H7Br2Cl2O4P/c1-10-13(9,11-2)12-3(5)4(6,7)8/H3h,1-2H3 |
|
|
Yes |
|
|
Insecticide, Acaricide |
|
|
Organophosphate insecticide; Organophosphate acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-systemic with rapid contact and stomach action. Cholinesterase inhibitor. |
|
|
300-76-5 |
|
|
206-098-3 |
|
|
195 |
|
|
034401 |
|
|
4420 |
|
|
015-055-00-6 |
|
|
380.79 |
|
|
- |
|
|
(RS)-1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
|
|
1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
|
|
Marine Pollutant; Chemical subject to PIC regulations; PAN listed Highly Hazardous Chemical |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Aedes nigromaculis, Boophilus microplus, Delia antiqua, Musca domestica, Myzus persicae, Rhizoglyphus robini, plus others |
|
|
Colourless to yellow liquid |
|
|
|
|
|
- Amvac
- Tekchem
- Ningbo Yihwei Chemicals Co. Ltd.
|
|
|
- Bansect
- Clean Crop
- Dibrom
- Hopkins
|
|
|
Available in a variety of formulations including emulsifiable concentrates, liquids and LVCs. |
|
|
|
|
|
|
|
2000 |
|
High |
|
|
820000 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Heptane |
- |
|
|
27.0 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.51 X 1002 |
Calculated |
- |
|
|
2.18 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.97 |
|
- |
|
|
- |
- |
- |
| - |
|
|
260 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Highly volatile |
|
|
6.60 |
H4 H = The US ARS pesticide properties database. Dataset is no longer available. 4 = Verified data |
Moderately volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
1 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
4.4 |
|
Moderately fast |
|
|
- |
|
|
|
0.7 |
|
Non-persistent |
|
|
pH sensitive: 4 days at pH 5, 0.1 days at pH 9 |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Moderately mobile |
|
|
180 |
|
|
Best available data |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.00 |
Calculated |
Low leachability |
|
|
|
4.30 X 10-04 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
598 |
Estimated |
Threshold for concern |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
83 |
Rat |
High |
|
|
|
- |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source Rat 2 year |
- |
|
|
100 |
- |
|
|
- |
- |
- |
|
|
> 52 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 0.002 |
Apis mellifera |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
0.0245 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
High |
|
|
Contact |
|
|
|
0.0016 |
R4 R = Peer reviewed scientific publications 4 = Verified data Nomia melanderi |
High |
|
|
Contact |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 0.195 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
0.00035 |
Daphnia magna |
High |
|
|
- |
- |
- |
|
|
0.0077 |
Americamysis bahia |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.8 |
Lemna gibba |
Moderate |
|
|
0.00035 |
W2 W = French database provided by ARVALIS-Institut du Végétal. Dataset no longer available. 2 = Unverified data of unknown source Pseudokirchneriella subcapitata |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
83 |
Rat |
High |
|
|
800 |
Rat |
- |
|
|
0.2 |
Rat 4 hr |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
- |
|
|
May be absorbed from the gastrointestinal tract, by inhalation and through the intact skin |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Harmful if swallowed or in contact with skin May cause mild testicular degeneration |
|
|
|
|
|
Corrosive IMDG Transport Hazard Class 6.1 |
|
|
Health: H302, H312, H315, H319 Environment: H400 |
|
|
II (Moderately hazardous) |
|
|
UN3018 |
|
|
- |
|
|
- |
|
|
|
|
|
naled |
|
|
naled |
|
|
Naled |
|
|
naled |
|
|
naled |
|
|
naled |
|
|
naled |
|
|
naled |
|
|
- |
|
|
- |
|
|
naled |
|
|
- |