| Monocrotophos (Ref: ENT 27129) |
(Also known as: azadrin; corophos; OMS 834) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity High alert: Birds acute ecotoxicity: High; Daphnia acute ecotoxicity: High; Bees acute contact ecotoxicity: High; Bees acute oral ecotoxicity: High
 |
Human health High alert: Mammals acute toxicity: High; Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
Used to control sucking and chewing pests typically on cotton, citrus and many other crops |
|
|
Aphids; Common mites; Ticks; Spiders; Caterpillars |
|
|
Cotton; Palms; Ornamental conifers; Ornamental shrubs and flowers; Peanuts; Sugarcane; Citrus; Olives |
|
|
- |
|
|
Banned in many countries |
|
|
- |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Italy |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Exists in the cis- and trans-forms.The cis-form is the major constituent of the technical material. |
|
|
C₇H₁₄NO₅P |
|
|
C/C(=C\C(=O)NC)/OP(=O)(OC)OC |
|
|
C/C(=C\C(=O)NC)/OP(=O)(OC)OC |
|
|
KRTSDMXIXPKRQR-AATRIKPKSA-N |
|
|
InChI=1S/C7H14NO5P/c1-6(5-7(9)8-2)13-14(10,11-3)12-4/h5H,1-4H3,(H,8,9)/b6-5+ |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| monocrotophos |
- |
 |
|
|
Insecticide, Acaricide |
|
|
Organophosphate insecticide; Organophosphate acaricide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Broad spectrum, systemic with stomach and contact action. Acetylcholinesterase (AChE) inhibitor. |
|
|
6923-22-4 |
|
|
230-042-7 |
|
|
287 |
|
|
058903 |
|
|
5371562 |
|
|
015-072-00-9 |
|
|
223.16 |
|
|
dimethyl (2E)-4-(methylamino)-4-oxobut-2-en-2-yl phosphate |
|
|
dimethyl (E)-1-methyl-2-(methylcarbamoyl)vinyl phosphate |
|
|
dimethyl (1E)-1-methyl-3-(methylamino)-3-oxo-1-propenyl phosphate |
|
|
Chemical subject to GB PIC regulations Annex III; Marine Pollutant; Rotterdam Convention (Class Ib) |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
Bemisia tabaci, Boophilus microplus, Cacopsylla pyri, Earias vittella, Lygus hesperus, Spodoptera littoralis, many others |
|
|
Colourless crystals when pure reddish-brown as technical substance |
|
|
|
|
|
- BASF
- AgroCare
- King Tech Corp
- United Phosphorus
|
|
|
- Nuvacron
- Crisodrin
- Monophos
- Monodrin
- Phoskill
|
|
|
Available as a water soluble concentrate and ULV formulation |
|
|
|
|
|
|
|
818000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source |
High |
|
|
700000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Acetone |
- |
| 1000000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Methanol |
- |
| 10000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Toluene |
- |
| 292000 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source Ethanol |
- |
|
|
54 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
6.03 X 10-01 |
Calculated |
- |
|
|
-0.22 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.16 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
- |
|
|
- |
- |
- |
| - |
|
|
0.29 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Low volatility |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
7 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
30 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Literature values for soil DT₅₀ range 1-35 days |
|
|
|
5.0 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 2.4-7.8 days, 2 field grown crops, various matrices, n=2 |
|
|
|
3.7 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.3-14.5 days, 10 field grown crops, various matrices, n=11 |
|
|
|
26 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Slow |
|
|
- |
|
|
|
134 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source |
Mobile |
|
|
19 |
|
|
Literature values for Koc range 0.9-30.8 mL g⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
4.02 |
Calculated |
High leachability |
|
|
|
8.78 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Low |
Calculated |
- |
|
|
Mobile |
Calculated |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
14 |
Rat |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 0.94 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Colinus virginianus |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
35 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
0.13 |
K3 K = Research datasets (e.g. Pandora, Demetra; these datasets no longer available). Norman Ecotoxicology database. (click here ) 3 = Unverified data of known source Apis mellifera |
High |
|
|
0.02 |
R4 R = Peer reviewed scientific publications 4 = Verified data Apis mellifera |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data Megachile rotundata |
Moderate |
|
|
Contact |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 7.0 |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
0.023 |
Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
14 |
Rat |
High |
|
|
157 |
J4 J = Pesticide Action Network database (click here ) 4 = Verified data Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.0006 |
|
- |
|
|
0.002 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I; List II |
- |
- |
|
|
|
Minimal risk from food residues Exposure by general public unlikely |
|
|
Full protective clothing required including respirator to minimise operator and worker exposure May be absorbed through skin |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
In mammals, 60-65% is excreted within 24 hours, predominantly in the urine |
G3 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
Highly toxic orally |
|
|
|
|
|
Corrosive IMDG Transport Hazard Class 6.1 |
|
|
Health: H300, H311; H330; H340 Environment: H400, H410 |
|
|
Ib (Highly hazardous) |
|
|
UN2783 |
|
|
- |
|
|
- |
|
|
|
|
|
monocrotophos |
|
|
monocrotophos |
|
|
Monocrotophos |
|
|
- |
|
|
- |
|
|
monocrotofos |
|
|
- |
|
|
monokrotofos |
|
|
- |
|
|
- |
|
|
- |
|
|
- |