| Mirex (Ref: GC 1283) |
(Also known as: perchlordecone; perchlorodihomocubane; dodecaclor; ENT 25719; dechlorane) |
| Mirex is an obsolete organochlorine insecticide. Toxic to humans and know to be a carcinogen. Mirex is also a reproduction and CNS toxin. It is practically insoluble and takes several years to degrade in soil. It is not expected to leach into groundwater but will accumulate in sediements. Environmentally persistent and will bioaccumulate. Moderately toxic to wildlife. |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: Potential for particle bound transport: High
 Warning: Significant data are missing |
Ecotoxicity Moderate alert: Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Bees acute unknown ecotoxicity: Moderate
 |
Human health High alert: Carcinogen; Endocrine distrupter
 |
|
|
Now banned, Mirex was used to control ants and had several other non pesticide uses |
|
|
Fire ants; Harvester ants |
|
|
Agricultural fields; Non-cropped areas |
|
|
- |
|
|
Considered obsolete but may be available in some countries; Banned in many countries |
|
|
1946, first reported |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
None |
|
|
C₁₀Cl₁₂ |
|
|
C12(C3(C4(C5(C3(C(C1(C5(C2(C4(Cl)Cl)Cl)Cl)Cl)(Cl)Cl)Cl)Cl)Cl)Cl)Cl |
|
|
- |
|
|
GVYLCNUFSHDAAW-UHFFFAOYSA-N |
|
|
InChI=1S/C10Cl12/c11-1-2(12)7(17)4(14)3(13,5(1,15)9(7,19)20)6(1,16)10(21,22)8(2,4)18 |
|
|
Yes |
|
|
Insecticide |
|
|
Organochloride insecticide; Cyclodiene insecticide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Central nervous system stimulant with contact activity, ingested toxin. |
|
|
2385-85-5 |
|
|
219-196-6 |
|
|
375 |
|
|
039201 |
|
|
16945 |
|
|
602-077-00-1 |
|
|
545.54 |
|
|
1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachloro-1,1a,3,3a,4,5,5a,5b-octahydro-1H-1,3,4-(epimethanetriyl)cyclobuta[cd]pentalene |
|
|
dodecachloropentacyclodecane |
|
|
1,1a,2,2,3,3a,4,5,5,5a,5b,6-dodecachlorooctahydro-1,3,4-metheno-1H-cyclobuta[cd]pentalene |
|
|
POP; LRTAP Annex I; OSPAR soc; Marine Pollutant; Banned 1978 |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
2A |
|
|
Not applicable |
|
|
- |
|
|
White crystalline solid |
|
|
|
|
|
- Allied Chemical Corp.
- Seppic
|
|
|
|
|
|
- |
|
|
|
|
|
|
|
0.0001 |
|
Low |
|
|
17000 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Chloroform |
- |
| 14300 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Xylene |
- |
|
|
485 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.91 X 1005 |
Calculated |
- |
|
|
5.28 |
|
High |
|
|
|
Likely to be soluble |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
Based on chemical group |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
839.4 |
|
Volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
300 |
|
Persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Environmentally stable, DT₅₀ circa 3000+ days, some reports say up to 10 years (R3) |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
|
- |
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
|
|
Stable |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
Stable |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Non-mobile |
|
|
5794 |
|
|
Log10 Koc 3.763 |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
0.59 |
Calculated |
Low leachability |
|
|
|
1.16 X 10-02 |
Calculated |
- |
|
|
- |
|
|
High |
Calculated |
- |
|
|
Non-mobile |
Calculated |
- |
|
|
|
51400 |
|
High potential |
|
|
Not available |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 235 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2400 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
7.15 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 100 |
Oncorhynchus mykiss |
Low |
|
|
40 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Oncorhynchus mykiss 5 day |
Low |
|
|
> 0.1 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.1 |
Chlorella pyrenoidosa |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 235 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
Moderate |
|
|
2000 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
List I |
- |
- |
|
|
|
Main concerns were from food residues but substance is now obsolete and banned in most countries so risk now minimal |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
✓Yes, known to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Moderately toxic Liver, thyroid and kidney toxicant Endocrine issues - Weak estrogen effect |
|
|
|
|
|
No information available |
|
|
- |
|
|
Not classified: Obsolete |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
mirex |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |