| Metolachlor (Ref: CGA 24705) |
(Also known as: metolachlore) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate Moderate alert: GUS: Transition state; Drainflow: Moderately mobile; Potential for particle bound transport: Medium
 |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Daphnia chronic ecotoxicity: Moderate; Earthworms acute ecotoxicity: Moderate
 |
Human health High alert: Endocrine distrupter
 |
|
|
A pre-emergence herbicide used to control certain weeds in a variety of situations |
|
|
Broad-leaved; Annual grassy weeds |
|
|
Corn; Soybeans; Sorghum; Potatoes; Cotton; Safflower; Stone fruits; Nuts; Woody ornamentals |
|
|
- |
|
|
Current |
|
|
1976 |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
A molecule with two chiral centres. The technical product is an isomeric mixture containing both the R- and S-enantiomers |
|
|
C₁₅H₂₂ClNO₂ |
|
|
CCC1=CC=CC(=C1N(C(C)COC)C(=O)CCl)C |
|
|
No data |
|
|
WVQBLGZPHOPPFO-UHFFFAOYSA-N |
|
|
InChI=1S/C15H22ClNO2/c1-5-13-8-6-7-11(2)15(13)17(14(18)9-16)12(3)10-19-4/h6-8,12H,5,9-10H2,1-4H3 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| S-metolachlor |
S-isomer |
 |
|
|
Herbicide |
|
|
Chloroacetanilide herbicide |
|
|
>95% |
|
|
- |
|
|
Synthetic |
|
|
Selective, reduces seed germination. Inhibition of VLCFA (inhibition of cell division). |
|
|
51218-45-2 |
|
|
257-060-8 |
|
|
400 |
|
|
108801 |
|
|
4169 |
|
|
No data found |
|
|
283.79 |
|
|
- |
|
|
2-chloro-N-(6-ethyl-o-tolyl)-N-[(1RS)-2-methoxy-1-methylethyl]acetamide |
|
|
2-chloro-N-(2-ethyl-6-methylphenyl)-N-(2-methoxy-1-methylethyl)acetamide |
|
|
Potential groundwater contaminant |
|
|
- |
|
|
K3 |
|
|
15 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Lolium rigidum |
|
|
Tan to colourless oily liquid |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
Usually formulated as an emulsifiable concentrate |
|
|
|
|
|
|
|
530 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Benzene |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Acetone |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Hexane |
- |
| Miscible |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Xylene |
- |
|
|
-51.05 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
406.8 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
- |
- |
- |
|
|
190 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
2.51 X 1003 |
Calculated |
- |
|
|
3.4 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.12 |
E4 E = Manufacturers safety data sheets 4 = Verified data |
- |
|
|
Not applicable |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
| No dissociation |
|
|
1.7 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Low volatility |
|
|
2.40 X 10-03 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
90 |
DW4 DW = Don Wauchope personal database for Pka data: Wauchope, R. D. and Edwards, J. Dissociation constants for pesticide active ingredients: a database and comparison with predicted values. Dataset is no longer available. 4 = Verified data |
Moderately persistent |
|
|
15 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
21 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature lab studies DT₅₀ range 8-38 days, field studies DT₅₀ range 11-31 days (Switerland and France): Other sources: DT₅₀ 6-100 days (R3), 26 days at 25 °C (R4 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
9.1 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.0-17.4 days, 3 field & undercover grown crops, various matrices, n=3 |
|
|
|
Stable |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Stable |
|
|
- |
|
|
|
Stable |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Stable |
|
|
- |
|
|
365 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Stable |
|
|
88 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Stable |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
0.67 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile |
|
|
120 |
|
|
Literature value: Kd range 0.33-1.64 mL g⁻¹, Koc range 50.0-540 mL g⁻¹, soils=33; Other sources: 120.2-309.0 mL g⁻¹ (R3), Log Koc 2.26 at 25 °C (R4) |
|
|
|
0.93 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
Moderately mobile |
|
|
163 |
|
|
0.888 |
|
|
Literature values: Study 1 - Kf range 0.07-2.57 mL g⁻¹, Kfoc range 51.7-600 mL g⁻¹, 1/n range 0.55-1.35, Soils=36; study 2 - Kf range 4.8-26.7 mL g⁻¹, Kfoc range 421-3679 mL g⁻¹, 1/n range 0.47-1.10, soils=5 (R4) |
|
|
- |
|
|
|
|
|
|
|
2.36 |
Calculated |
Transition state |
|
|
|
1.03 X 10-01 |
Calculated |
- |
|
|
- |
|
|
Medium |
Calculated |
- |
|
|
Moderately mobile |
Calculated |
- |
|
|
|
68.8 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Whole fish |
Low potential |
|
|
1.5 |
- |
|
|
|
|
|
|
|
Major fraction |
0.1 |
- |
|
|
Major fraction |
0.10 |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 1200 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Moderate |
|
|
|
90 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
High |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
140 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 110 |
Apis mellifera |
Low |
|
|
110 |
|
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 3.9 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Oncorhynchus mykiss |
Moderate |
|
|
1.0 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Cyprinodon variegatus |
Moderate |
|
|
> 23.5 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Daphnia magna |
Moderate |
|
|
> 0.707 |
Daphnia magna LOEC |
Moderate |
|
|
4.2 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.043 |
Lemna gibba |
Moderate |
|
|
> 57.1 |
Pseudokirchneriella subcapitata |
Low |
|
|
3.0 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Anabaena sp. |
Low |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 1200 |
G4 G = Extension Toxicology network database EXTOXNET. Available online but no longer updated. (click here ) 4 = Verified data Rat |
Moderate |
|
|
5050 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
2.02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
Non-statutory WHO drinking water guideline 0.01 mg l⁻¹ |
B5 B = UK CRD and ACP Evaluation Documents / and other DEFRA (UK) documents; Also Chemicals Regulation Division, Health and Safety Executive (HSE), UK (click here ) 5 = Verified data used for regulatory purposes UK EA QS database 2018 |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
✓Yes, known to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
XNo, known not to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
May cause convulsions, diarrhoea, jaundice, weakness, nausea, sweating and dizziness USEPA - possible human carcinogen Endocrine issues - Pregnane X cellular receptor activation |
|
|
|
|
|
No information available |
|
|
Health: H317 Environment: H400, H410 |
|
|
III (Slightly hazardous) |
|
|
- |
|
|
- |
|
|
Limited shelf-life |
|
|
|
|
|
metolachlor |
|
|
metolachlore |
|
|
Metolachlor |
|
|
metolachlor |
|
|
metolaclor |
|
|
metolacloro |
|
|
metolachlor |
|
|
metolachlor |
|
|
- |
|
|
metolachlor |
|
|
metolachloor |
|
|
- |