| Methacrifos (Ref: CGA 20168 ) |
(Also known as: (E)-methacrifos; trans-methacrifos) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Moderate alert: Fish acute ecotoxicity: Moderate
 Warning: Significant data are missing |
Human health High alert: Acetyl cholinesterase inhibitor; Neurotoxicant
 |
|
|
An obsolete broad spectrum insecticide sometimes used to protect grain in storage from various arthropod pests |
|
|
Flour beetle; Grain mites; Grain moths |
|
|
Grain storage |
|
|
- |
|
|
Considered obsolete but may be available in some countries |
|
|
1977, first reported |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| |
|
|
|
|
|
|
|
|
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| |
|
|
|
|
|
|
|
|
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
The (E)-isomer of methacrifos |
|
|
C₇H₁₃O₅PS |
|
|
CC(=COP(=S)(OC)OC)C(=O)OC |
|
|
C/C(=C\OP(=S)(OC)OC)/C(=O)OC |
|
|
NTAHCMPOMKHKEU-AATRIKPKSA-N |
|
|
InChI=1S/C7H13O5PS/c1-6(7(8)9-2)5-12-13(14,10-3)11-4/h5H,1-4H3/b6-5+ |
|
|
Yes |
|
|
Insecticide, Acaricide |
|
|
Organophosphate insecticide; Organothiophosphate insecticide; Organophosphate acaricide; Organothiophosphate acaricide |
|
|
>93% |
|
|
- |
|
|
Synthetic |
|
|
Cholinesterase inhibitor, stomach, contact and respiratory action with rapid knockdown and some residual activity |
|
|
62610-77-9 |
|
|
30864-28-9 |
|
|
250-366-2 |
|
|
466 |
|
|
- |
|
|
3034435 |
|
|
015-156-00-5 |
|
|
240.22 |
|
|
methyl (2E)-3-[(dimethoxyphosphorothioyl)oxy]-2-methylprop-2-enoate |
|
|
methyl (E)-3-(dimethoxyphosphinothioyloxy)-2-methylacrylate |
|
|
methyl (2E)-3-[(dimethoxyphosphinothioyl)oxy]-2-methyl-2-propenoate |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
1B |
|
|
Not applicable |
|
|
- |
|
|
Colourless liquid |
|
|
|
|
|
|
|
400 |
|
Moderate |
|
|
- |
- |
- |
|
|
25 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
- |
|
|
90 |
L2 L = Pesticide manuals and hard copy reference books / other sources 2 = Unverified data of unknown source |
- |
|
|
200 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
69 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
|
3.39 X 1001 |
Calculated |
- |
|
|
1.53 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.225 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
160 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Highly volatile |
|
|
9.61 X 10-02 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
Non-volatile |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Low risk |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Based on LogP < 3 |
Low risk |
|
|
- |
- |
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
|
| S-(2-trans-methoxycarbonyl-2-methylvinyl)-glutathion |
- |
Mammals |
- |
- |
| methylmalonylsemialdehyde |
- |
Mammals |
- |
- |
| N-acetyl-S-(2-methoxycarbonylprop-1-enyl)cysteine |
- |
Mammals |
- |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
678 |
Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 10000 |
Phasianidae |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
0.4 |
Oncorhynchus mykiss 14 °C |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
678 |
Rat |
Moderate |
|
|
3100 |
Rat |
- |
|
|
2.2 |
V3 V = ChemID Online Databases; Chemspider; PubChem. (ChemID ) 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
0.006 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Rapidly absorbed, metabolised and excreted in mammals |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
No data found |
|
|
|
|
Harmful if swallowed |
|
|
|
|
|
IMDG Transport Hazard Class 9 Incompatible with strong acids and alkalis |
|
|
Health: H302, H317 Environment: H410 |
|
|
II (Moderately hazardous) |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
methacrifos |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |