| Mesosulfuron (Ref: AE F154851) |
(Also known as: mesosulfuron acid) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
Environmental fate High alert: GUS: High leachability; Drainflow: Mobile
 |
Ecotoxicity Moderate alert: Bees acute contact ecotoxicity: Moderate; Bees acute oral ecotoxicity: Moderate
 |
Human health Moderate alert: Neurotoxicant
 |
|
|
A herbicide, usually used as the methyl variant, for post-emergence control of grasses and weeds in cereals. Also a pesticide transformation product |
|
|
Grasses including blackgrass; Broad-leaved weeds |
|
|
Cereals including spring wheat, winter wheat, durum wheat |
|
|
- |
|
|
Current |
|
|
- |
|
|
Approved |
|
|
30/06/2032 |
|
|
Check label - may vary with formulation |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
France/Poland |
|
|
30/06/2032 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
|
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
|
|
|
|
|
None |
|
|
C₁₆H₁₉N₅O₉S₂ |
|
|
COC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)C2=C(C=CC(=C2)CNS(=O)(=O)C)C(=O)O)OC |
|
|
- |
|
|
MAYMYMXYWIVVOK-UHFFFAOYSA-N |
|
|
InChI=1S/C16H19N5O9S2/c1-29-12-7-13(30-2)19-15(18-12)20-16(24)21-32(27,28)11-6-9(8-17-31(3,25)26)4-5-10(11)14(22)23/h4-7,17H,8H2,1-3H3,(H,22,23)(H2,18,19,20,21,24) |
|
|
Yes |
|
|
Herbicide, Metabolite |
|
|
Soil |
|
|
Sulfonylurea herbicide; Pirimidinylsulfonylurea herbicide |
|
|
930 g kg⁻¹ |
|
|
EU dossier - None declared |
|
|
Synthetic |
|
|
Inhibits plant amino acid synthesis - acetohydroxyacid synthase AHAS |
|
|
400852-66-6 |
|
|
609-783-9 |
|
|
663 |
|
|
- |
|
|
11520759 |
|
|
No data found |
|
|
489.48 |
|
|
2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-4-(methanesulfonamidomethyl)benzoic acid |
|
|
2-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-a-(methanesulfonamido)-p-toluic acid |
|
|
2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-4-[[(methylsulfonyl)amino]methyl]benzoic acid |
|
|
Potential groundwater contaminant |
|
|
- |
|
|
B |
|
|
2 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
|
|
|
- |
|
|
Formulations normally use the methyl variant. |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
56.1 |
|
Moderately persistent |
|
|
56.1 |
|
Moderately persistent |
|
|
39.7 |
|
Moderately persistent |
|
|
214.3 |
|
Persistent |
|
|
186 |
|
- |
|
|
- |
- |
- |
|
|
EU 2016 dossier lab studies DT₅₀ range 18.7-148.9 days, DT₉₀ range 62.2-254.9 days, Soils=10; Field studies DT₅₀ range 4-100 days, DT₉₀ range 30-423 days |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
1.55 |
|
Mobile |
|
|
68.3 |
|
|
0.94 |
|
|
EU dossier kf range 0.75-3.1 mL g⁻¹; Kfoc 46-98 mL g⁻¹; 1/n range 0.92-0.95; Soils=3 |
|
|
- |
|
|
|
|
|
|
|
3.46 |
Calculated |
High leachability |
|
|
|
5.19 X 10-01 |
Calculated |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Anas platyrhynchos as methyl variant |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 1000 |
Eisenia foetida |
Low |
|
|
125.0 |
Eisenia foetida 56d |
Low |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
1000 |
Folsomia candida 28d |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 13 |
as methyl variant 72 hr |
Moderate |
|
|
> 5.6 |
as methyl variant 72 hr |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 100 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terrestris |
Low |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 100 |
Oncorhynchus mykiss as methyl variant |
Low |
|
|
- |
- |
- |
|
|
> 100 |
Daphnia magna as methyl variant |
Low |
|
|
95.0 |
Pimephales promelas as methyl variant 32d |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.0 |
|
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
0.13 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
No data found |
| Eye irritant |
Phototoxicant |
|
✓Yes, known to cause a problem |
No data found |
|
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Environment: H400, H410 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
mesosulfuron |
|
|
mesosulfuron |
|
|
Mesosulfuron |
|
|
mesosulfuron |
|
|
mesosulfuron |
|
|
mesosulfuron |
|
|
- |
|
|
kwas mezosulfuronowy |
|
|
mesosulfuron |
|
|
- |
|
|
- |
|
|
- |