| Mepiquat |
(Also known as: mepiquat ion) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
Ecotoxicity Moderate alert: Birds chronic ecotoxicity: Moderate; Fish chronic ecotoxicity: Moderate; Daphnia acute ecotoxicity: Moderate; Earthworms chronic ecotoxicity: Moderate
 |
Human health Moderate alert: Mammals acute toxicity: Moderate; Mammals chronic toxicity: Moderate
 |
|
|
A plant growth regulator used to reduce vegetative growth. It is usually used as the chloride salt. |
|
|
Growth |
|
|
Cereals including wheat, oats, barley, rye, triticale; Grass; Onions; Leeks; Garlic |
|
|
- |
|
|
Current |
|
|
1980 |
|
|
Approved |
|
|
28/02/2029 |
|
|
Check label - may vary with formulation |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
Finland/Estonia |
|
|
28/02/2024 |
|
|
No |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
|
✓ |
✓ |
✓ |
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
|
✓ |
✓ |
|
✓ |
✓ |
✓ |
✓ |
|
|
|
|
|
|
None |
|
|
C₇H₁₆N |
|
|
C[N+]1(CCCCC1)C |
|
|
- |
|
|
NNCAWEWCFVZOGF-UHFFFAOYSA-N |
|
|
InChI=1S/C7H16N/c1-8(2)6-4-3-5-7-8/h3-7H2,1-2H3/q+1 |
|
|
Yes |
|
|
Plant Growth Regulator, Herbicide |
|
|
Quarternary ammonium PGR |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Inhibits biosynthesis of gibberellic acid |
|
|
15302-91-7 |
|
|
604-881-8 |
|
|
440 |
|
|
- |
|
|
18743 |
|
|
No data found |
|
|
114.21 |
|
|
1,1-dimethylpiperidin-1-ium |
|
|
1,1-dimethylpiperidinium |
|
|
1,1-dimethylpiperidinium |
|
|
- |
|
|
- |
|
|
Not known |
|
|
Not known |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
Solid |
|
|
|
|
|
|
|
|
- BASF
- Anpon
- Barclay
- United AgriProducts
|
|
|
- Canopy
- Cyclade
- Barclay Banshee
|
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.82 X 10-04 |
Calculated |
- |
|
|
-3.55 |
as acid |
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
3.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 2.8-4.3, 2 field crops, whole plant matrix, n=2 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
2.0 |
as acid |
Low potential |
|
|
- |
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
1490 |
Rat |
Moderate |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
> 155 |
Rat Reproductive NOAEL as chloride variant |
Moderate |
|
|
> 2000 |
Colinus virginianus as chloride variant |
Low |
|
|
- |
- |
- |
|
|
> 100.7 |
Coturnix japonica NOAEL as chloride variant |
Moderate |
|
|
> 3195 |
Eisenia foetida as chloride variant |
Low |
|
|
31.25 |
Eisenia foetida as chloride variant |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
> 100 |
as chloride variant |
Low |
|
|
> 107.4 |
as chloride variant |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
> 100 |
Oncorhynchus mykiss as chloride variant |
Low |
|
|
100 |
Oncorhynchus mykiss as chloride variant |
Low |
|
|
68.5 |
Daphnia magna as chloride variant |
Moderate |
|
|
12.5 |
Daphnia magna as chloride variant |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
15.4 |
Lemna gibba as chloride variant |
Low |
|
|
> 44.8 |
Aphanizomenon flos-aquae as chloride variant |
Low |
|
|
14.4 |
Aphanizomenon flos-aquae as chloride variant |
Low |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
1490 |
Rat |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.2 |
|
- |
|
|
0.3 |
|
- |
|
|
- |
- |
- |
|
|
0.3 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Minimal risk from dietary exposure Risk assessment indicates ARfD would not normally be exceded |
|
|
Risk of exposure acceptable under label recommendations for use for personal protection clothing and equipment |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
No data found |
| Eye irritant |
Phototoxicant |
|
?Possibly, status not identified |
No data found |
|
|
|
|
Moderately toxic |
|
|
|
|
|
Prevent generation of mists |
|
|
Health: H302 Environment: H412 |
|
|
II (Moderately hazardous) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
mepiquat |
|
|
mepiquat |
|
|
Mepiquat |
|
|
mepiquat |
|
|
mepiquat |
|
|
mepicuat |
|
|
- |
|
|
mepikwatu |
|
|
mepikvat |
|
|
- |
|
|
- |
|
|
- |