| Mecoprop-P dimethylammonium |
(Not known by any other names) |
The following alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement.
| Environmental fate |
Ecotoxicity |
Human health |
| |
|
Human health High alert: Reproduction/development effects
 |
|
|
Mecoprop-P dimethylammonium rapidly breaks to mecoprop-P which is a herbicide for post-emergence control of broad-leaved weeds on grass |
|
|
Cleavers; Chickweed; Clover; Plantains; Ground ivy; Knotweed; Bluegrasses; Bent grass |
|
|
Lawns; Sports fields; Golf courses; Fairways; Cereals including wheat, barley, oats, triticale |
|
|
Well established herbicide used across the Europe for broad leaved weed control for many years. |
|
|
Current |
|
|
- |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Approved |
|
|
UK/Ireland |
|
|
31/01/2024 |
|
|
No |
|
|
Yes - as mecoprop-P |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
|
✓ |
✓ |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
| ✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
✓ |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
| ✓ |
|
✓ |
✓ |
✓ |
|
|
✓ |
|
|
|
|
|
|
|
This substance is the herbicidally active D+ isomer of a variant of chiral mecoprop |
|
|
C₁₂H₁₈ClNO₃ |
|
|
CC1=C(C=CC(=C1)Cl)OC(C)C(=O)O.CNC |
|
|
CC1=C(C=CC(=C1)Cl)O[C@H](C)C(=O)O.CNC |
|
|
ROGDGDPDLIVQFZ-OGFXRTJISA-N |
|
|
InChI=1S/C10H11ClO3.C2H7N/c1-6-5-8(11)3-4-9(6)14-7(2)10(12)13;1-3-2/h3-5,7H,1-2H3,(H,12,13);3H,1-2H3/t7-;/m1./s1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
| Common Name |
Relationship |
Link |
| Mecoprop |
Parent |
 |
|
|
Herbicide |
|
|
Phenoxypropionic herbicide |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Selective, systemic, absorbed through leaves and translocated to roots. Synthetic auxin. |
|
|
66423-09-4 |
|
|
613-932-3 |
|
|
475 |
|
|
- |
|
|
68515001 |
|
|
No data found |
|
|
259.73 |
|
|
(2R)-2-(4-chloro-2-methylphenoxy)propanoic acid—N-methylmethanamine (1/1) |
|
|
(R)-2-[(4-chloro-o-tolyl)oxy]propionic acid - dimethylamine (1:1) |
|
|
(2R)-2-(4-chloro-2-methylphenoxy)propanoic acid compound with N-methylmethanamine (1:1) |
|
|
- |
|
|
- |
|
|
O |
|
|
4 |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
- |
|
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Does not dissociate |
Q4 Q = Miscellaneous data from online sources 4 = Verified data |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
Not readily biodegradable |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
Cannot be calculated |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
- |
- |
- |
|
|
2000 |
Rat |
- |
|
|
4.66 |
Rat |
- |
|
|
- |
- |
- |
|
|
0.01 |
as mecoprop-P |
- |
|
|
None allocated |
|
- |
|
|
- |
- |
- |
|
|
0.04 |
as mecoprop-P |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
No unacceptable risks to bystanders identified |
|
|
No unacceptable risks to operators or other workers using PPE/PPC identified |
|
|
|
| EU MRL pesticide database |
|
|
|
|
|
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Excreted mainly via urine - 95% in 24 hrs |
|
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A3 A = Chromosome aberration (EFSA database) 3 = Negative ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
|
XNo, known not to cause a problem |
XNo, known not to cause a problem |
|
|
|
|
Possible kidney & liver toxicant |
|
|
|
|
|
Not expected to autoignite, Not highly flammable Not explosive or oxidising IMDG Transport Hazard Class 9 |
|
|
Health: H302, H317 Environment: H400, H410 |
|
|
- |
|
|
UN3077 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
mecoprop-P dimethylammonium |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |